dàn âm thanh hội trường, âm thanh lớp học, âm thanh phòng họp, loa trợ giảng

Câu hỏi trắc nghiệm este lipit có đáp án

Câu hỏi trắc nghiệm este lipit có đáp án

 

Câu hỏi trắc nghiệm este – lipit theo các mức độ nhận thức

 Phân dạng theo các cấp độ nhận thức

 

câu hỏi trắc nghiệm este - lipit

  1. Mức độ nhận biết

Câu 1: Etyl axetat không tác dụng với

  1. H2O (xúc tác H2SO4 loãng, đun nóng). B. H2 (xúc tác Ni, nung nóng).
  2. dung dịch Ba(OH)2 (đun nóng). D. O2, to.

Câu 2: Este nào sau được điều chế trực tiếp từ  axit và ancol ?

  1. vinyl fomat. B. etyl axetat.
  2. phenyl axetat. D. vinyl axetat.

Câu 3: Este X khi tác dụng với dung dịch NaOH thu được 2 muối là natri phenolat và natri propionat. X có công thức là

  1. A. C6H5-OOC-CH3.           B. C6H5-COO-CH2-CH3.
  2. C. CH3-CH2-COO-C6H5. D. CH3-COO-C6H5.

Câu 4: Tripanmitin có công thức là

  1. (C17H31COO)3C3H5. B. (C17H35COO)3C3H5. C. (C15H31COO)3C3H5. D. (C17H33COO)3C3H5.

Câu 5: Etyl fomat là chất mùi thơm, không độc, được dùng làm chất tạo hương trong công nghiệp thực phẩm, có phân tử khối là:

  1. 88. B. 74. C. 60.  D. 68.

Câu 6: Chất nào sau đây không có phản ứng tráng bạc:

  1. C2H2. B. CH3CH=O. C. HCOOCH3. D. HCOOCH=CH2.

Câu 7: Trong công nghiệp, một lượng lớn chất béo dùng để sản xuất

  1. glucozơ và glixerol. B. xà phòng và ancol etylic.
  2. glucozơ và ancol etylic. D. xà phòng và glixerol.

Câu 8: Khi xà phòng hóa tripanmitin ta thu được sản phẩm là

  1. C17H35COOH và glixerol. B. C15H31COONa và etanol.
  2. C15H31COONa và glixerol. D. C15H31COOH và glixerol.

Câu 9: Chất nào sau đây tác dụng với dung dịch NaOH sinh ra glixerol?

  1. Triolein. B. Metyl axetat. C. Glucozơ.          D. Saccarozơ.

Câu 10: Khi xà phòng hoá tristearin ta thu được sản phẩm là

  1. C17H35COOH và glixerol. B. C15H31COONa và glixerol.
  2. C15H31COOH và glixerol. D. C17H35COONa và glixerol.

Câu 11: Axit nào sau đây là axit béo?

  1. Axit ađipic. B. Axit axetic. C. Axit glutamic. D. Axit stearic.

Câu 12: Phản ứng giữa C2H5OH với CH3COOH là phản ứng

  1. trùng hợp. B. este hóa. C. xà phòng hóa.  D. trùng ngưng.

Câu 13: Chất X có công thức cấu tạo CH2=CH – COOCH3. Tên gọi của X là

  1. propyl fomat. B. metyl axetat. C. metyl acrylat.   D. etyl axetat.

Câu 14: Ở điều kiện thích hợp, hai chất phản ứng với nhau tạo thành metyl fomat là

  1. CH3COONa và CH3OH. B. HCOOH và CH3OH.
  2. HCOOH và C2H5NH2. D. HCOOH và NaOH.

Câu 15: Monome dùng đề điều chế thủy tinh hữu cơ là :

  1. CH3COOCH=CH2. B. CH2=C(CH3)COOCH3.
  2. CH2=CHCOOC2H5. D. CH2=C(CH3)COOC2H5.

Câu 16: Công thức của triolein là :

  1. (CH3[CH2]7CH=CH[CH2]7COO)3C3H5. B. (CH3[CH2]7CH=CH[CH2]5COO)3C3H5.
  2. (CH3[CH2]16COO)3C3H5. D. (CH3[CH2]14COO)3C3H5.

Câu 17: Este nào sau đây có công thức phân tử ?

  1. Propyl axetat. B. Vinyl axetat. C. Phenyl axetat.  D. Etyl axetat.

Câu 18: Chất không phải là chất béo là

  1. axit axetic. B. tripanmitin. C. triolein.                                       D. tristearin.

Câu 19: Chất béo là trieste của axit béo với

  1. ancol etylic. B. ancol metylic. C. etylen glicol.                       D. glixerol.

Câu 20: Este no, đơn chức, mạch hở có công thức phân tử tổng quát là

  1. CnH2n+2O2 (n ≥ 2). B. CnH2nO2 (n ≥ 1).
  2. CnH2nO2 (n ≥ 2). D. CnH2nO (n ≥ 2).

Câu 21: Este X có công thức cấu tạo thu gọn CH3COOCH2CH2CH3. Vậy tên gọi của X là

  1. metyl butirat. B. propyl axetat.
  2. etyl propionat. D. isopropyl axetat.

Câu 22: Este CH3CH2CH2COOC2H5 có tên gọi là

  1. etyl butirat. B. etyl butiric.
  2. etyl propanoat. D. etyl butanoat.

Câu 23: Đun nóng este CH3COOC2H5 với một lượng vừa đủ dung dịch NaOH, sản phẩm thu được là

  1. CH3COONa và CH3OH. B. HCOONa và C2H5OH.
  2. C2H5COONa và CH3OH. D. CH3COONa và C2H5OH.

Câu 24: Etyl axetat có công thức là

  1. CH3COOCH3. B. CH3CH2COOCH3.
  2. CH3COOC2H5. D. CH3COOCH=CH2.

Câu 25: Chất X có công thức cấu tạo thu gọn HCOOCH3. Tên gọi của X là:

  1. etyl fomat. B. metyl fomat.
  2. metyl axetat. D. etyl axetat.

Câu 26: Tỉ khối hơi của một este no, đơn chức X so với hiđro là 30. Công thức phân tử của X là:

  1. C3H6O2. B. C5H10O2. C. C4H8O2.       D. C2H4O2.

Câu 27: Các este thường có mùi thơm dễ chịu: isoamyl axetat có mùi chuối chín, etyl butirat có mùi dứa chín, etyl isovalerat có mùi táo,…Este có mùi chuối chín có công thức cấu tạo thu gọn là:

  1. CH3COOCH2CH(CH3)2. B. CH3COOCH2CH2CH(CH3)2.
  2. CH3COOCH2CH(CH3)CH2CH3.D. CH3COOCH(CH3)CH2CH2CH3.

Câu 28: Axit cacboxylic nào dưới đây là axit đơn chức

  1. Axit ađipic. B. Axit terephtalic.
  2. Axit oleic. D. Axit oxalic.

Câu 29: Thuỷ phân C2H5COOCH=CH2 trong môi trường axit tạo thành những sản phẩm là

  1. C2H5COOH; HCHO.                       B. C2H5COOH; C2H5OH.
  2. C2H5COOH; CH3CHO. D. C2H5COOH; CH2=CH-OH.

Câu 30: Hợp chất X có công thức cấu tạo như sau: CH3COOCH3. Tên gọi đúng của X là

  1. etyl axetat. B. metyl axetat.
  2. đimetyl axetat. D. axeton.

Câu 31: Trong các hợp chất sau, hợp chất nào là chất béo?

  1. (C2H3COO)3C3H5. B. (C17H31COO)3C3H5.            
  2. (C2H5COO)3C3H5. D. (C6H5COO)3C3H5.

Câu 32: Tripanmitin có công thức là

  1. (C17H31COO)3C3H5. B. (C17H35COO)3C3H5.
  2. (C15H31COO)3C3H5. D. (C17H33COO)3C3H5.

Câu 33: Tên gọi nào sai

  1. phenyl fomat : HCOOC6H5. B. vinyl axetat : CH2=CH-COOCH3.
  2. metyl propionat : C2H5COOCH3. D. etyl axetat : CH3COOCH2CH3.
  3. Mức độ thông hiểu

Câu 34: Hợp chất X có công thức phân tử C5H8O2, khi tham gia phản ứng xà phòng hóa thu được một anđehit và một muối của axit cacboxylic. Số đồng phân cấu tạo thỏa mãn tính chất trên của X là

  1. 3. B. 2.     C. 5.    D. 4.

Câu 35: Hợp chất hữu cơ X tác dụng được với dung dịch KOH và dung dịch brom nhưng không tác dụng với dung dịch KHCO3. Tên gọi của X là

  1. axit acrylic. B. vinyl axetat. C. anilin.          D. etyl axetat.

Câu 36: Công thức chung của este tạo bởi ancol thuộc dãy đồng đẳng của ancol etylic và axit thuộc dãy đồng đẳng của axit axetic là công thức nào sau đây ?

  1. CnH2nO2 (n ≥ 2). B. CnH2n-2O2 (n ≥ 2)
  2. CnH2n-4O2 (n ≥ 3) D. CnH2n+2O2 (n ≥ 3).

Câu 37: Cho sơ đồ phản ứng:

Số công thức cấu tạo của X phù hợp sơ đồ trên là

  1. 1. B. 2. C. 3.    D. 4.

Câu 38: Hợp chất hữu cơ X tác dụng với một lượng vừa đủ dung dịch NaOH, sau đó cô cạn dung dịch thu được chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với lượng dư dung dịch AgNO3/NH3 thu được chất hữu cơ T. Cho T tác dụng với dung dịch NaOH lại thu được chất Y. X là

  1. CH3COOCH=CH-CH3. B. CH3COOCH=CH2. C. HCOOCH3. D. HCOOCH=CH2.

Câu 39: Phát biểu nào sau đây là đúng?

  1. Vinyl axetat không làm mất màu dung dịch brom.
  2. Ancol etylic không tạo liên kết hiđro với nước.
  3. Este iso amyl axetat có mùi dứa chín.
  4. Lipit là những hợp chất hữu cơ có trong tế bào sống, không hòa tan trong nước, nhưng hòa tan trong các dung môi hữu cơ không phân cực.

Câu 40: Chất hữu cơ đơn chức, mạch hở X (C5H8O2) có các tính chất sau:

(1) Tác dụng được với dung dịch NaOH nhưng không tác dụng được với Na.

(2) Không tham gia được phản ứng tráng gương.

Số công thức cấu tạo của X trong trường hợp này là

  1. 6. B. 7. C. 5.                            D. 8.

Câu 41: Chất nào sau đây khi thủy phân tạo các chất đều có phản ứng tráng gương?

  1. HCOOCH=CH2. B. HCOOCH3.
  2. CH3COOCH3. D. CH3COOCH=CH2.

Câu 42: Chất nào sau đây tác dụng với NaOH theo tỷ lệ mol 1:3?

  1. CH3COOC2H5. B. C2H4(OOCCH3)2.
  2. C6H5OOCCH3. D. CH3OOC-COOC6H5.

Câu 43: Đốt cháy hoàn toàn este X thu được số mol CO2 bằng số mol H2O. Vậy X là

  1. este đơn chức, no, mạch hở.
  2. este đơn chức, có 1 vòng no.
  3. este đơn chức, mạch hở, có một nối đôi.
  4. este hai chức no, mạch hở.

Câu 44: Công thức phân tử tổng quát của este tạo bởi ancol no, đơn chức, mạch hở và axit cacboxylic không no, có một liên kết đôi C=C, đơn chức, mạch hở là

  1. CnH2n-2O2. B. CnH2n+1O2.
  2. CnH2nO2. D. CnH2n+2O2.

Câu 45: Công thức tổng quát của este sinh bởi axit đơn chức no, mạch hở và ancol  thuộc dãy đồng đẳng của ancol benzylic là:

  1. CnH2n-8O2 B. CnH2n-8O2
  2. CnH2n-4 O2. D. CnH2n-6O2.

Câu 46: Phát biểu nào sau đây sai ?

  1. Trong công nghiệp có thể chuyển hoá chất béo lỏng thành chất béo rắn.
  2. Số nguyên tử hiđro trong phân tử este đơn và đa chức luôn là một số chẵn.
  3. Sản phẩm của phản ứng xà phòng hoá chất béo là axit béo và glixerol.
  4. Nhiệt độ sôi của este thấp hơn hẳn so với ancol có cùng phân tử khối.

Câu 47: Cho chất X tác dụng với một lượng vừa đủ dung dịch KOH, sau đó cô cạn dung dịch thu được chất rắn Y và chất hữu cơ Z. Cho Z tác dụng với dung dịch AgNO3 trong NH3 thu được chất hữu cơ T. Cho T tác dụng với dung dịch KOH lại thu được chất Y. Chất X có thể là:

  1. HCOOCH=CH2. B. CH3COOCH=CH2.
  2. CH3COOCH=CH-CH3. D. HCOOCH3.

Câu 48: Công thức tổng quát của este thuần chức tạo bởi ancol no hai chức và axit không no có một nối đôi đơn chức là

  1. CnH2n–6O4. B. CnH2n–2O4. C. CnH2n–4O4.       D. CnH2n–8O4.

Câu 49: Thủy phân este X trong môi trường axit, thu được hai chất hữu cơ Y và Z. Từ Y có thể chuyển hóa thành Z bằng một phản ứng. Chất X không thể là

  1. etyl axetat. B. metyl axetat.
  2. isopropyl propionat. D. vinyl axetat.

Câu 50: Phát biểu nào sau đây là đúng?

  1. Axit béo là những axit cacboxylic đa chức.
  2. Este isoamyl axetat có mùi chuối chín.
  3. Ancol etylic tác dụng được với dung dịch NaOH.
  4. Etylen glicol là ancol no, đơn chức, mạch hở.

Link download bản đầy đủ 170 câu trắc nghệm bản pdf

Không có đáp án PHÂN DẠNG CÂU HỎI TRẮC NGHIỆM ESTE – LIPIT

Có đáp án PHÂN DẠNG CÂU HỎI TRẮC NGHIỆM ESTE – LIPIT

Xem thêm

Tổng hợp các chuyên đề hóa học lớp 10

Tổng hợp các chuyên đề hóa học lớp 11

Tổng hợp các chuyên đề hóa học lớp 12

Phân dạng bài tập este lipit

Câu hỏi trắc nghiệm cacbohiđrat

Phân dạng bài tập cacbohiđrat


Comments

4 responses to “Câu hỏi trắc nghiệm este lipit có đáp án”

  1. thanh hoa Avatar
    thanh hoa

    tải tài liệu

    1. Polime Avatar
      Polime

      Bạn xuống cuối bài đăng có dòng chữ “Link download bản đầy đủ 170 câu trắc nghệm bản pdf” click vào link ở đó là tải được tài liệu về!

  2. Nguyen Khoi Avatar
    Nguyen Khoi

    Dạ thầy ơi cho xin đáp án được không ạ

    1. Polime Avatar
      Polime

      Admin đã upload file có đáp án in đỏ rồi, em có thể tải về và xem nhé!

Leave a Reply

Your email address will not be published. Required fields are marked *