dàn âm thanh hội trường, âm thanh lớp học, âm thanh phòng họp, loa trợ giảng

Đề thi hsg lớp 12 môn hóa tỉnh Quảng Bình năm 2023 2024

Đề thi hsg lớp 12 môn hóa tỉnh Quảng Bình năm 2023 2024

SGK, sách ôn thi, sách tham khảo giá rẻ

1

SỞ GD VÀ ĐT QUẢNG BÌNH
HƯỚNG DẪN CHẤM
KỲ THI CHỌN HSG TỈNH NĂM HỌC 2023-2024
Khóa ngày 05 tháng 12 năm 2023
Môn thi: HÓA HỌC
Bài thi tự luận
LỚP 12 THPT
Đap an nay gồm có 04 trang

YÊU CẦU CHUNG
– Đap an chỉ trình bay một lời giải cho mỗi bai; học sinh có thể trình bay nhiều cach khac nhau nhưng
phải đảm bảo tính logic, khoa học, nếu đúng vẫn được điểm tối đa.
– Nếu học sinh giải đúng trọn vẹn kết quả của 1 ý theo yêu cầu đề ra thì cho điểm trọn ý ma không cần
tính điểm từng bước nhỏ, nếu từng ý giải không hoan chỉnh, có thể cho 1 phần của tổng điểm tối đa
danh cho cho ý đó.
Câu 1. (1,5 điểm)
1. Viết các phương trình hóa học xảy ra trong các thí nghiệm sau:
a) Cho lượng nhỏ tristearin vào ống nghiệm chứa dung dịch NaOH loãng, dư rồi đun nóng. Để
nguội ống nghiệm rồi thêm tiếp vào đó vài giọt dung dịch CuSO4.
b) Tiến hành trùng hợp metyl metacrylat ở điều kiện thích hợp.
c) Axit axetylsalixylic tác dụng với dung dịch NaOH dư, đun nóng.
d) Thủy phân tripeptit Glu-Ala-Gly trong dung dịch KOH dư, đun nóng.
2. Cho sơ đồ chuyển hóa sau:
+ X + Y + X + Y
NaOH Z NaOH E BaCO     3 .
Biết X, Y, Z, E là các hợp chất khác nhau, chọn một cặp chất X, Y thỏa mãn sơ đồ trên và viết các
phương trình hóa học của các phản ứng xảy ra.
3. Viết phương trình hóa học của các phản ứng (xảy ra ở điều kiện thường) được ứng dụng vào thực
tiễn sau:
a) Dùng bạc kim loại để cạo gió cho người bị cảm.
b) Thu hồi thủy ngân rơi vãi bằng bột lưu huỳnh.
c) Dùng khí NH3 để loại bỏ khí clo trong phòng thí nghiệm.

Câu 1Nôi dungĐiểm
1a)
(C17H35COO)3C3H5 + 3NaOH
3C17H35COONa + C3H5(OH)3
2C3H5(OH)3 + Cu(OH)2 → (C3H7O3)2Cu + 2H2O
c) o-HOOCC6H4OOCCH3 + 3NaOH
o-NaOOCC6H4ONa + CH3COONa + 2H2O
d) HOOC[CH2]2CH(NH2)CONHCH(CH3)CONHCH2COOH + 4KOH
KOOC[CH2]2CH(NH2)COOK + H2NCH(CH3)COOK + H2NCH2COOK + 2H2O
0,25
0,125
0,125
0,125
2X là CO2, Y là Ba(OH)2, Z và E là hai chất Na2CO3, NaHCO3.
Có thể X là Ba(HCO3)2, Y là Ba(OH)2.
2NaOH + CO2 → Na2CO3 + H2O
Na2CO3 + Ba(OH)2 → BaCO3 + 2NaOH
NaOH + CO2 → NaHCO3
NaHCO3 + Ba(OH)2 → BaCO3 + NaOH + H2O
0,25
0,25
3a) 4Ag + 2H2S + O2 → 2Ag2S + 2H2O
b) Hg + S → HgS
c) 8NH3 + 3Cl2 → N2 + 6NH4Cl
0,125
0,125
0,125


Câu 2. (1,0 điểm)
1. Hợp chất MX2 có trong một loại quặng phổ biến trong tự nhiên. Hòa tan MX2 trong dung dịch
HNO3 đặc, nóng, thu được dung dịch A. Cho dung dịch BaCl2 vào A thu được kết tủa trắng, cho A tác
dụng với dung dịch NH3 dư, thu được kết tủa đỏ nâu.
a) Xác định hợp chất MX2. Viết các phương trình phản ứng dạng ion thu gọn.
b) Nước ở các khe suối, nơi có hợp chất MX2 thường có pH rất thấp. Giải thích hiện tượng này bằng
phương trình phản ứng.
2. Cho hỗn hợp X gồm Fe3O4 và Cu tác dụng dung dịch HCl , sau khi các phản ứng xảy ra hoàn toàn thu được
dung dịch Y và một phần kim loại không tan. Cho dung dịch Y vào dung dịch KMnO4 trong H2SO4 loãng, dư.
Viết phương trình hóa học của các phản ứng xảy ra.

Câu 2Nôi dungĐiểm
1a) MX2 là FeS2.
FeS2 + 14H+ + 15NO3- → Fe3+ + 2SO42- + 15NO2 + 7H2O
SO42- + Ba2+ → BaSO4
Fe3+ + 3NH3 + 3H2O → Fe(OH)3 + 3NH4+
b) Trong tự nhiên, O2 không khí hòa tan trong nước oxi hóa FeS2:
2FeS2 + 7O2 + 2H2O → 2Fe2+ + 4H++ 4SO42-
H2SO4 sinh ra làm nước suối có pH thấp.
0,25
0,25
2Fe3O4 + 8HCl → 2FeCl3 + FeCl2 + 4H2O
Cu + 2FeCl3 → CuCl2 + 2FeCl2
5Fe2+ + MnO4 + 8H+  5Fe3+ + Mn2+ + 4H2O
10Cl + 2MnO4 + 16H+  5Cl2↑ + 2Mn2+ + 8H2O
0,125
0,125
0,125
0,125

Câu 3. (1,5 điểm)
1. Hợp chất X có công thức phân tử C14H16O4N2. Biết X không làm mất màu brom trong CCl4 và X
được tạo thành từ chất hữu cơ Y và chất hữu cơ T; Y tác dụng với dung dịch brom tạo ra kết tủa trắng.
Hoàn thành các phương trình hóa học sau dưới dạng công thức cấu tạo thu gọn:

SGK, sách ôn thi, sách tham khảo giá rẻ
X + 2NaOH → 2Y + Z + 2H2O
E + NaOH → Y + NaCl + H2O
(1)
(3)
X + 2HCl → T + 2E
Z + 2HCl → T + 2NaCl
(2)
(4)

3. Ba chất hữu cơ X1, Y1, Z1 có cùng công thức phân tử C4H8O2, có đặc điểm sau:
+ X1 có mạch cacbon phân nhánh, tác dụng được với Na và NaOH.
+ Y1 được điều chế trực tiếp từ axit và ancol có cùng số nguyên tử cacbon.
+ Z1 tác dụng được với NaOH và tham gia phản ứng tráng bạc.
Xác định các chất X1, Y1, Z1 và viết các phương trình phản ứng xảy ra.

Câu 3Nôi dungĐiểm
1* Công thức cấu tạo X: C6H5NH3OOC-COOH3NC6H5; Y: C6H5NH2;
Z: NaOOC-COONa; T: HOOC-COOH; E: C6H5NH3Cl.
* Các phương trình phản ứng:
C6H5NH3OOC-COOH3NC6H5 + 2NaOH → 2C6H5NH2 + NaOOC-COONa + 2H2O
(X) (Y) (Z)
C6H5NH3OOC-COOH3NC6H5 + 2HCl → HOOC-COOH + 2C6H5NH3Cl
(X) (T) (E)
C6H5NH3Cl + NaOH → C6H5NH2 + NaCl + H2O
(E) (Y)
NaOOC-COONa + 2HCl → HOOC-COOH + 2NaCl
(T) (T)
0,25
0,25
0,25
0,25
2X1 là: CH3CH(CH3)-COOH; Y1 là: CH3COOC2H5 ; Z1 là: HCOOC3H7.
CH3CH(CH3)-COOH + Na → CH3CH(CH3)-COONa + 1/2H2
CH3CH(CH3)-COOH + NaOH CH3CH(CH3)-COONa + H2O
CH3COOH + C2H5OH
CH3COOC2H5 + H2O
C3H7OOCH + 2[Ag(NH3)2]OH C3H7OOCONH4 + H2O + 3NH3 + 2Ag
0,125
0,125
0,125
0,125

 H SO 2 4, to

  t0
3
Câu 4. (1,0 điểm)
1. Hòa tan hoàn toàn 58,2 gam hỗn hợp X gồm Cu, Fe và Fe3O4 trong 450 gam dung dịch HNO3
35%, sau phản ứng thu được dung dịch Y chỉ chứa 186,5 gam muối và hỗn hợp khí Z. Cho dung dịch
chứa 2,5 mol NaOH vào Y lọc bỏ kết tủa, cô cạn phần dung dịch rồi nung đến khối lượng không đổi
thu được 165,25 gam chất rắn T. Tính phần trăm khối lượng Fe3O4 trong X.
2. Trộn 100 ml dung dịch axit HCOOH 0,4M với 100 ml dung dịch axit C2H5COOH 0,4M thu được
200 ml dung dịch X. Tính pH của X, biết hằng số Ka của HCOOH và C2H5COOH lần lượt là 1,77.10-4
và 1,34.10-5.

Câu 4Nôi dungĐiểm
1* Sơ đồ phản ứng:
Cu khí Z
58,2 g hh X Fe
Fe2+, Fe3+ kết tủa
Fe3O4 dd Y Cu2+
186,5g muối NO3- dd
165,25 g rắn T
* Nếu NaOH phản ứng hết thì trong T có 172,5 gam NaNO2 > mT.
=> NaOH dư.
trong T có: NaNO2: x mol; NaOH dư: y mol.
69x + 40y = 165,25 x = 2,25
x + y = 2,5 y = 0,25
* Khối lượng oxi trong X = 58,2 – (186,5 – 2,25.62) = 11,2 gam
=> nO = 0,7 mol =>
mol.
0,125
0,125
0,125
0,125
2Nồng độ của 2 axit sau khi trộn là: = = 0,2M.
Ta có các phương trình phân li axit:
Ka1 = 1,77.10-4 (1)
Ka2 = 1,34.10-5 (2)
Kw = 10-14 (3)
Ta thấy, .Ka1 ≈ .Ka2 >> Kw nên pH của dung dịch chỉ phụ thuộc
vào quá trình (1) và (2).
Ta có: Ka1 =
; Ka2 =
Theo định luật bảo toàn điện tích ta có:
=
+
(*)
Chấp nhận: [HCOOH] ≈ [C2H5COOH] ≈ 0,2M.
Giải được [H+] = 6,17.10-3M.
Kiểm tra lại: [HCOOH] =
= 0,1944M.
[C2H5COOH] =
= 0,1996M.
Thay hai nồng độ trên vào (*) ta được: [H+] = 6,17.10-3 (kết quả lặp lại).
Vậy pH = -lg[H+] = 2,21.
0,125
0,125
0,125
0,125

4
Câu 5. (1,0 điểm)
1. Cho 23,65 gam hỗn hợp X gồm Lysin và Tyrosin (axit 2-amino-3(4-hiđroxiphenyl)propanoic))
vừa đủ với 250 ml dung dịch HCl 1M (lượng tối đa) thu được dung dịch Y. Thêm tiếp 500 ml dung
dịch NaOH 1M vào Y rồi cô cạn dung dịch sau phản ứng thu được m gam chất rắn khan Y.
Viết các phương trình hóa học xảy ra và tính giá trị của m.
2. Hỗn hợp E gồm axit cacboxylic đơn chức X; ancol no, đa chức Y và chất Z là sản phẩm của phản
ứng este hóa giữa X với Y; trong E, số mol của X lớn hơn số mol của Y.
Tiến hành các thí nghiệm sau:
Thí nghiệm 1: Cho 0,5 mol E phản ứng với dung dịch NaHCO3 dư thu được 3,36 lít khí CO2 (ở đktc).
Thí nghiệm 2: Cho 0,5 mol E vào dung dịch NaOH dư, đun nóng thì có 0,65 mol NaOH phản ứng và
thu được 32,2 gam ancol Y.
Thí nghiệm 3: Đốt cháy 1 mol E bằng O2 dư thu được 7,3 mol CO2 và 5,7 mol H2O.
Tính phần trăm về khối lượng của Z trong hỗn hợp E, biết các phản ứng xảy ra hoàn toàn.

SGK, sách ôn thi, sách tham khảo giá rẻ
Câu 5Nôi dungĐiểm
1* Các PTHH xảy ra:
H2N-[CH2]4-CH(NH2)-COOH + 2HCl → ClH3N-[CH2]4-CH(NH3Cl)-COOH
HO-C6H4-CH2-CH(NH2)-COOH + HCl → HO-C6H4-CH2-CH(NH3Cl)-COOH
Thêm tiếp dung dịch NaOH thì có phản ứng:
ClH3N-[CH2]4-CH(NH3Cl)-COOH + 3NaOH
→ H2N-[CH2]4-CH(NH2)-COONa + 2NaCl + 3H2O
HO-C6H4-CH2-CH(NH3Cl)-COOH + 3NaOH
→ NaO-C6H4-CH2-CH(NH2)-COONa + NaCl + 3H2O
* Tính giá trị của m:
Ta có nHCl = 0,25 mol; nNaOH = 0,5 mol.
Gọi số mol của Lys, Tyr lần lượt là x, y.
mhh = 146x + 181y = 23,65 gam.
nHCl = 2x + y = 0,25
Giải hệ phương trình ta được: x = 0,1; y = 0,05.
Ta có:
= nNaOH phản ứng = 3x + 3y = 0,45 mol.
BTKL: mhh + mHCl + mNaOH = mchất rắn +
=> 23,65 + 0,25.36,5 + 0,5.40 = m + 0,45.18 => m = 44,675 gam.
0,125
0,125
0,125
0,125
2– TN1: nX =
= 0,15 mol nY + nZ = 0,5 – 0,15 = 0,35 mol.
– TN2: nancol Y thu được = nY + nZ = 0,35 mol MY =
Y phù hợp là C3H5(OH)3
Số nhóm este trong Z là m.
nNaOH = 0,15 + m.nZ = 0,65; với nZ < 0,35:
m = 3 => nZ =
=> nY = 0,18 > nX => loại.
m = 2 => nZ = 0,25 => nY = 0,1 < nX => thỏa mãn.
m = 1 => nZ = 0,5 => loại.
– TN3: Vì ở TN 3 dùng 1 mol nên ta quy về 0,5 mol cho giống các TN còn lại.
CaHbCOOH: 0,15 mol; C3H5(OH)3: 0,1 mol; (CaHbCOO)2C3H5OH: 0,25 mol.
Z là: (C3H5COO)2C3H5OH: 0,25 mol.
Khối lượng hỗn hợp E: mE = 0,15.86 + 0,1.92 + 0,25.228 = 79,1 gam.
%mZ =
= 72,06%.
0,125
0,125
0,125
0,125

O2 Education gửi các thầy cô link download đề thi

SGK, sách ôn thi, sách tham khảo giá rẻ

Các thầy cô có thể xem thêm nhiều đề thi hsg của các tỉnh khác tại

Tổng hợp đề thi hsg lớp 10 môn hoá học

Tổng hợp đề thi hsg lớp 11 môn hóa học

Tổng hợp đề thi HSG lớp 12 môn hoá học

SGK, sách ôn thi, sách tham khảo giá rẻ

Hoặc xem thêm các tài liệu khác của môn hóa


Comments

Leave a Reply

Your email address will not be published. Required fields are marked *