dàn âm thanh hội trường, âm thanh lớp học, âm thanh phòng họp, loa trợ giảng

Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020

Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020

SỞ GIÁO DỤC VÀ ĐÀO TẠO

QUẢNG TRỊ

ĐỀ CHÍNH THỨC

(Đề thi có 2 trang)

KỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 12 THPT

Khóa ngày 02 tháng 10 năm 2019

Môn thi: HÓA HỌC 12

Thời gian làm bài: 180 phút

(không kể thời gian giao đề)

Câu 1. (4,0 điểm)

1. Nêu hiện tượng và viết các phương trình phản ứng xảy ra với mỗi trường hợp sau:

a) Cho dung dịch H2SO4 đặc vào saccarozơ sau đó đun nhẹ.

b) Cho dung dịch FeCl2 vào dung dịch AgNO3 dư.

c) Cho đạm Ure vào dung dịch nước vôi trong.

d) Cho từ từ dung dịch H2SO4 đến dư vào dung dịch NaAlO2.

2. Cho hỗn hợp rắn gồm FeS2, NaCl, NaBr và NaI phản ứng với dung dịch axit H2SO4 đặc, nóng, thu được hỗn hợp khí. Viết các phương trình phản ứng xảy ra.

3. Cho m gam Na vào 300 ml dung dịch hỗn hợp A gồm HCl 1M và AlCl3 0,5M. Viết các phương trình phản ứng và tính giá trị của m để khi kết thúc các phản ứng thu được 0,1 mol kết tủa.

4. Hòa tan hoàn toàn Al bằng V ml dung dịch H2SO4 1M và HCl 1M, thu được dung dịch Y chứa Al2(SO4)3, AlCl3 và H2SO4. Cho từ từ đến dư dung dịch Ba(OH)2 vào Y, thấy khối lượng kết tủa tạo thành phụ thuộc vào số mol Ba(OH)2 theo đồ thị hình bên. Dựa vào đồ thị, hãy viết các phản ứng ứng xảy ra ứng với mỗi đoạn và tìm giá trị của y.

Câu 2. (4,0 điểm)

1. Ở trạng thái cơ bản, nguyên tử của nguyên tố R có cấu hình electron lớp ngoài cùng là 4s1. Viết cấu hình electron, xác định vị trí trong bảng tuần hoàn và tính số electron độc thân của nguyên tử nguyên tố R ở trạng thái cơ bản.

2. Viết phương trình phản ứng dưới dạng ion thu gọn cho các thí nghiệm sau:

a) Hòa tan FeSx trong dung dịch HNO3 đặc, dư và đun nóng.

b) Cho dung dịch K2S dư vào dung dịch Fe2(SO4)3.

c) Cho dung dịch NH4HSO4 vào dung dịch Ba(HSO3)2.

d) Cho a mol kim loại Ba vào dung dịch chứa a mol NH4HCO3.

3. Cho hỗn hợp gồm a mol Mg và b mol Cu tác dụng với 200 ml dung dịch hỗn hợp AgNO3 0,3M và Cu(NO3)2 0,25 M. Sau phản ứng hoàn toàn thu được dung dịch A và chất rắn B. Cho A tác dụng với dung dịch NaOH dư, lọc lấy kết tủa nung trong không khí đến khối lượng không đổi thu được 3,6 gam hỗn hợp gồm 2 oxit. Hòa tan hoàn toàn B trong H2SO4 đặc, nóng được 0,09 mol khí SO2. Tính giá trị của a và b.

4. Hòa tan hoàn toàn 27,04 gam hỗn hợp X gồm Mg, Al, Al2O3 Mg(NO3)2 vào dung dịch chứa hai chất tan NaNO3 và 1,08 mol H2SO4 (loãng). Sau khi kết thúc các phản ứng, thu được dung dịch Y chỉ chứa các muối và 0,28 mol hỗn hợp Z gồm N2O, H2. Tỷ khối của Z so với H2 bằng 10. Dung dịch Y tác dụng tối đa với dung dịch chứa 2,28 mol NaOH, thu được 27,84 gam kết tủa. Tính phần trăm khối lượng của nhôm kim loại có trong X.

Câu 3. (4,0 điểm)

  1. Nêu hiện tượng xảy ra và viết phương trình phản ứng khi cho:

a) Dung dịch Na2CO3 vào dung dịch FeCl3.

b) Dòng khí H2S qua dung dịch FeCl3.

c) Dung dịch KI vào dung dịch FeCl3, khi phản ứng xong cho thêm vài giọt hồ tinh bột.

d) Từ từ dung dịch NaHSO4 vào dung dịch Na2CO3 theo tỉ lệ số mol 1:1 và đun nóng.

2. Sắp xếp các dung dịch: H2SO4, HCl, NaOH, Na2CO3 và Na2SO4 có cùng nồng độ 0,1M theo chiều tăng pH của dung dịch và giải thích bằng số liệu cụ thể thứ tự sắp xếp đó.

3. Hòa tan hoàn toàn m gam hỗn hợp X gồm Fe và kim loại M (hóa trị n không đổi) trong dung dịch H2SO4 đặc, nóng, dư, thu được dung dịch A và khí SO2 (sản phẩm khử duy nhất). Hấp thụ hết lượng SO2 bằng dung dịch chứa 0,1 mol NaOH (dư), thu được dung dịch chứa 5,725 gam chất tan. Thêm vào m gam X một lượng kim loại M gấp đôi lượng kim loại M có trong X, thu được hỗn hợp Y. Cho Y tan hết trong dung dịch HCl dư, thu được 0,0775 mol H2. Thêm vào m gam X một lượng Fe bằng lượng Fe có trong X, thu được hỗn hợp Z. Cho Z tác dụng với dung dịch H2SO4 loãng, dư, thu được dung dịch B chứa 5,605 gam muối. Viết các phương trình phản ứng và xác định M.

4. Hòa tan hoàn toàn 6,84 gam hỗn hợp E gồm Mg và kim loại M có hóa trị không đổi cần một lượng dung dịch HNO3 loãng, vừa đủ, thu được 0,896 lít (đktc) hỗn hợp khí X gồm N2 và N2O có tỉ khối so với H2 là 16 và dung dịch F. Chia F thành 2 phần bằng nhau. Đem cô cạn phần 1, thu được 25,28 gam muối khan. Phần 2 cho tác dụng với dung dịch NaOH dư, thu được 4,35 gam kết tủa. Viết các phương trình phản ứng và xác định kim loại M.

Câu 4. (4,0 điểm)

1. Xác định các chất A1, A2, A3, A4, A5, A6 là các hiđrocacbon khác nhau và viết các phương trình phản ứng theo sơ đồ chuyển hóa sau đây:

2. Các chất hữu cơ A, B, C, D có cùng công thức phân tử C4H6O4 đều phản ứng với dung dịch NaOH theo tỷ lệ mol 1:2. Trong đó: A, B đều tạo ra một muối, một rượu; C, D đều tạo ra một muối, một rượu và nước. Biết rằng khi đốt cháy muối do A, C tạo ra thì trong sản phẩm cháy không có nước. Xác định A, B, C, D và viết phương trình phản ứng với dung dịch NaOH.

3. Đốt cháy 26,7 gam chất hữu cơ F bằng không khí vừa đủ, sản phẩm cháy cho qua bình 1 đựng H2SO4 đặc, dư và bình 2 đựng nước vôi trong dư. Kết thúc các phản ứng, khối lượng bình 1 tăng thêm 18,9 gam, bình 2 xuất hiện 90 gam kết tủa, khí thoát ra khỏi bình 2 có thể tích 104,16 lít (đktc). Cho không khí có 20% thể tích là O2 và 80% thể tích là N2, F có công thức phân tử trùng với công thức đơn giản nhất. Xác định công thức phân tử của F.

4. Cho X và Y là hai axit cacboxylic đơn chức, mạch hở (có một nối đôi C=C); Z là ancol no, mạch hở; T là este ba chức tạo bởi X, Y và Z. Chia 40,38 gam hỗn hợp E gồm X, Y, Z, T thành 3 phần bằng nhau. Đốt cháy hoàn toàn phần 1, thu được 0,5 mol CO2 và 0,53 mol H2O. Phần 2 cho tác dụng với dung dịch brom dư, thấy có 0,05 mol Br2 phản ứng. Phần 3 cho tác dụng với lượng vừa đủ dung dịch hỗn hợp gồm KOH 1M và NaOH 3M, cô cạn, thu được m gam muối khan. Tìm giá trị của m.

Câu 5. (4,0 điểm)

1. Viết các phương trình phản ứng theo sơ đồ chuyển hóa sau:

Biết a mol C7H8O2 tác dụng vừa đủ với 2a mol Na, còn khi tác dụng với dung dịch NaOH thì cần a mol NaOH và các nhóm thế ở các vị trí liền kề.

2. Công thức đơn giản nhất của chất M là C3H4O3 và chất N là C2H3O3. Biết M là một axit no đa chức, N là một axit no chứa đồng thời nhóm chức –OH; M và N đều là mạch hở. Viết công thức cấu tạo có thể có của M và N.

3. Hỗn hợp P gồm hai anđehit đơn chức là đồng đẳng kế tiếp. Đem 10,4 gam P tác dụng hoàn toàn với dung dịch AgNO3 trong NH3 đun nóng, thu được 1 mol Ag. Nếu đem 10,4 gam P tác dụng hoàn toàn với H2 (xúc tác Ni, t0), thu được hỗn hợp X gồm hai ancol Y và Z (MY < MZ). Đun nóng X với H2SO4 đặc ở 1400C, thu được 4,52 gam hỗn hợp ba ete. Biết hiệu suất phản ứng tạo ete của Y bằng 50%. Viết các phương trình phản ứng và tính hiệu suất phản ứng tạo ete của Z.

4. Hỗn hợp X1 gồm 4 este mạch hở, trong đó có 1 este đơn chức và ba este hai chức là đồng phân của nhau. Đốt cháy hết 11,88 gam X1 cần 0,66 mol O2, thu được 0,57 mol CO­2. Đun nóng 11,88 gam X1 với 310 ml dung dịch NaOH 1M, cô cạn dung dịch sau phản ứng, thu được m gam chất rắn Y1 và phần hơi chỉ chứa 1 ancol đơn chức Z1. Cho hết lượng Z1 tác dụng với Na dư thì khối lượng bình chứa Na tăng 5,85 gam. Trộn m gam Y1 với CaO rồi nung nóng (không có mặt oxi), thu được 2,016 lít khí (đktc) một hiđrocacbon duy nhất. Biết các phản ứng xảy ra hoàn toàn. Viết các phương trình phản ứng và công thức cấu tạo của các este trong hỗn hợp X1.

Cho: H=1; C=12; N=14; O=16; Na=23; Mg=24; Al=27; S=32; Cl=35,5;
Ca=40; Fe=56; Cu=64; Ag=108; Ba=137.

—————– HẾT —————–

Thí sinh được dùng bảng tuần hoàn và tính tan, không được sử dụng tài liệu khác

HƯỚNG DẪN CHẤM ĐỀ THI CHÍNH THỨC MÔN HÓA HỌC

KỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 12 THPT

Khóa ngày 02 tháng 10 năm 2019

Môn thi: HÓA HỌC

(Hướng dẫn chấm có 5 trang)

Câu

Ý

Nội dung

Điểm

Câu 1

1

a) C12H22O11 12C + 11H2O

C + 2H2SO4 đặc Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 1 CO2Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 2 + 2SO2Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 3 + 2H2O

b) Xuất hiện kết tủa trắng và dung dịch chuyển sang màu vàng nâu

FeCl2 + 2AgNO3 Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 4 2AgClĐề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 5 + Fe(NO3)2

Fe(NO3)2 + AgNO3 Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 6 Fe(NO3)3 + AgĐề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 7

c) Có khí mùi khai thoát ra và xuất hiện kết tủa trắng

(NH2)2CO + 2H2O Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 8 (NH4)2CO3

Ca(OH)2 + (NH4)2CO3 Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 9 CaCO3Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 10 + 2NH3Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 11 + 2H2O

d) Xuất hiện kết tủa keo trắng sau đó kết tủa tan ra trong axit dư

H2SO4 + 2 H2O + 2NaAlO2 Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 12 2Al(OH)­3 + Na2SO4

3H2SO4 + 2Al(OH)3 Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2020 13 Al2(SO4)3 + 6H2O

1,0

2

2FeS2 + 14H2SO4 đặc, nóng Fe2(SO4)3 + 15SO2 + 14H2O

NaCl + H2SO4 đặc, nóng NaHSO4 + HCl

2NaBr + 2H2SO4 đặc, nóng Na2SO4 + SO2 + Br2 + 2H2O

8NaI + 5H2SO4 đặc, nóng 4Na2SO4 + H2S + 4I2 + 4H2O

1,0

Do có kết tủa nên Na đã tác dụng với H2O

Mặt khác: số mol kết tủa < số mol AlCl3 có 2 TH xảy ra

Cho Na vào nước thu được dung dịch A

Na + HCl NaCl + 1/2 H2 (1)

Na + H2O NaOH + 1/2H2 (2)

3NaOH + AlCl3 Al(OH)3 + 3NaCl (3)

NaOH + Al(OH)3 NaAlO2 + 2H2O (4)

TH1: AlCl3 dư, không có (4)

Ta có: nNa = nHCl + 3nAl(OH)3 = 0,6 mol m = 0,6.23 = 13,8 gam

TH2: Kết tủa bị hòa tan một phần, có (4)

Ta có: nNa = nHCl + 4nAlCl3 – nAl(OH)3 = 0,3 + 0,15.4 – 0,1 = 0,8 mol

m = 0,8.23 = 18,4 gam

1,0

4

Phản ứng: 2Al + 6HCl→ 2AlCl3 + 3H2

x x/3

2Al + 3H2SO4→ Al2(SO4)3 + 3H2

3a a

H2SO4 + Ba(OH)2 → BaSO4↓+ 2H2O (đoạn 1)

x-3ax-3a x-3a

Al2(SO4)3 + 3Ba(OH)2 → 3BaSO4 + 2Al(OH)3 (đoạn 2)

a 3a 3a 2a

2AlCl3 + 3Ba(OH)2 → 3BaCl2 + 2Al(OH)3 (đoạn 3)

x/30,5x x/3

2Al(OH)3 + Ba(OH)2 → Ba(AlO2)2 + 4H2O (đoạn 4)

Tổng số mol Ba(OH)2 ở thời điểm khối lượng kết tủa cực đại là:

x -3a+3a+0,5x =1,5x =0,75 => x =0,5 mol

m↓(max)=233(x-3a+3a)+ 78(2a+x/3)=139,9

y = 233(x-3a)=233(0,5 -0,2)= 69,9 gam

1,0

Câu 2

1

Trường hợp 1: Cấu hình electron của X là [Ar] 4s1

X thuộc ô thứ 19, chu kì 4, nhóm IA

Ở trạng thái cơ bản, X có 1 electron độc thân.

Trường hợp 2: Cấu hình electron của X là [Ar] 3d5 4s1

X thuộc ô thứ 24, chu kì 4, nhóm VIB

Ở trạng thái cơ bản, X có 6 electron độc thân

Trường hợp 3: Cấu hình electron của X là [Ar] 3d10 4s1

X thuộc ô thứ 29, chu kì 4, nhóm IB

Ở trạng thái cơ bản, X có 1 electron độc thân

1,0

2

a) FeSx+(4x+6) H+ +(6x+3)NO3Fe3++xSO42- +( 6x+3) NO2+(2x+3) H2O

b) 3S2- + 2Fe3+ 2FeS + S

c) H+ + SO42- + HSO3 + Ba2+ BaSO4 + SO2 +H2O

d) Ba + 2 H2O Ba2+ + 2OH + H2

Ba2+ + 2OH + NH4+ + HCO3 BaCO3 + NH3 + 2H2O

1,0

3

Do tính oxi hóa của Ag+ > Cu2+ và tạo hỗn hợp 2 oxit AgNO3 hết, Mg hết

Ban đầu, đặt a, b là số mol Mg và Cu

nAg+ = 0,06 , nCu2+ = 0,05 , nSO2 = 0,09

Dung dịch A chứa Mg2+ (a mol), NO3 (0,16 mol) Cu2+: (0,08 – a) mol

Bảo toàn điện tích: nCu2+ = 0,08 – a mol

1,0

4

Quy đổi X thành Mg, Al ( a mol), NO3 (b mol), O (c mol) và đặt số mol NaNO3 là d mol. Ta có: 27,84 gam kết tủa là Mg(OH)2 nMg = 0,48 mol

Bảo toàn N:

Bảo toàn H:

1,0

Câu 3

1

a) Màu vàng của dd FeCl3 nhạt dần tạo kết tủa đỏ nâu và có khí bay lên

3Na2CO3 + 2FeCl3 +3H2O 2Fe(OH)3 + 3CO2 + 6NaCl

b) Màu vàng của dung dịch FeCl3 nhạt dần xuất hiện kết tủa trắng đục (vàng) của S

H2S + 2FeCl3 2FeCl2 + S + 2HCl.

c) Màu vàng của dung dịch FeCl3 nhạt dần, dung dịch chuyển thành màu xanh

2KI + 2FeCl3 2FeCl2 + I2 + 2KCl

d) NaHSO4 + Na2CO3 Na2SO4 + NaHCO3

Khi đun nóng có khí bay lên: 2NaHCO3 Na2CO3 + CO2 + H2O

1,0

2

Chiều pH tăng dần: H2SO4, HCl, Na2SO4, Na2CO3, NaOH

Giải thích:

+ H2SO4 2H+ + SO42- , [H+] = 2.0,1 = 0,2M pH = 1-lg2 = 0,7

+ HCl H+ + Cl , [H+] = 0,1 M => pH = 1

+ Na2SO4 2Na+ + SO42- pH = 7

+ Na2CO3 2Na+ + CO32-

CO32- + H2O HCO3 + OH có [OH] < 0,1 nên 7 <pH < 13

+ NaOH Na+ + OH có [OH] = 0,1 M [H+] = 10-13 pH = 13

1,0

3

2Fe + 6 H2SO4 đặc, nóng Fe2(SO4)3 + 3SO2 + 6H2O (1)

2M + 2n H2SO4 đặc, nóng M2(SO4)n + nSO2 +2nH2O (2)

SO2 + 2NaOH Na2SO3 + H2O (3)

Fe + H2SO4 FeSO4 + H2 (4); 2M + n H2SO4 M2(SO4)n + nH2 (5)

Fe + 2HCl FeCl2 + H2 (6); 2M + 2nHCl 2MCln + nH2 (7)

Theo (3):

1,0

4

Phản ứng: 8 + 10nHNO3 = 8 (NO3)n + nN2O + 5n H2O
10 + 12n HNO3 = 10 (NO3)n + nN2 + 6n H2O

(NO3)n + nNaOH (OH)n + nNaNO3

8 + 10n HNO3 8 (NO3)n + nNH4NO3 + 3n H2O

Có thể: M(OH)n + (4-n) NaOH Na4-nMO2 + 2H2O

Hỗn hợp X (0,04 mol):

Sơ đồ: E+ HNO3 F: Mg2+, Mn+, NO3 (muối KL), NH4NO3 (a) + N2 (0,03); N2O (0,01)

Ta có: nNO3 ( muối KL) = 0,03.10 + 0,01.8 +8a = 0,38 + 8a

mmuối = 25,28.2 = 6,84 + 62(0,38 + 8a) + 80a a=0,035

TH1: M(OH)n không lưỡng tính Kết tủa gồm: Mg(OH)2 và M(OH)n

Gọi x, y lần lượt là số mol của Mg và M trong hhE

Ta có:

TH2: M(OH)n lưỡng tính n Mg(OH)2 = 4,35.2/58= 0,15 mol =nMg

mM = 6,84 – 0,15.24 =3,24 gam

1,0

Câu 4

1

A6: CH4; A1: C2H2; A2: C2H4; A3: C4H10; A4: C4H4; A5: C4H6.

Các phản ứng:

2CH4 C2H2 + 3H2.

C2H2 + H2 C2H4

nC2H4 (-CH2CH2-)n

2C2H2 CH2=CH-C≡CH

CH2=CH-C≡CH + H2 CH2=CH-CH=CH2

CH2=CH-C=CH2 + 2H2 C4H10

C4H10 CH4 + C3H6

2C2H5OH CH2=CH-CH=CH2 + H2 + 2H2O

1,0

2

A, B + NaOH theo tỷ lệ mol 1: 2 1 muối và 1 rượu A, B: este 2 chức

H3C-OOC- COO-CH3 (A)+ 2 NaOH NaOOC-COONa + 2CH3OH

HCOO-CH2CH2 –OOCH (B) +2NaOH 2HCOONa +HOCH2-CH2 OH

C, D + NaOH theo tỷ lệ mol 1:2 muối + rượu + nước C, D là este axit

Do muối cháy không tạo H2O C là HOOC-COOC2H5, D là HOOC-CH2-COOCH3

HOOC- COOC2H5 + 2NaOH NaOOC – COONa + C2H5OH + H2O

HOOC-CH2-COOCH3 + 2NaOH NaOOC-CH2-COONa + CH3OH + H2O

1,0

3

Ta có mH2O = 18,9 gam 1,05 mol nH = 2,1 mol

mCaCO3 = 90 gam

Sơ đồ: 18,9 gam F + KK → 0,9 mol CO2 + 18,9 gam H2O + 4,65 mol N2

Theo ĐLBTKL: mKK = 0,9.44 + 18,9 + 4,65.28 – 26,7 = 162 gam

(do F)=4,65 1,125.4=0,15 mol

Tỉ số: nC:nH:nO:nN = 0,9:2,1:0,6:0,3 = 3:7:2:1

Công thức đơn giản nhất của F là C3H7O2N F là C3H7O2N

1,0

4

Quy E: CH2=CH-COOH, C3H5(OH)3: x mol, CH2: y mol và H2O: z mol

nCH2=CH-COOH = n Br2 = 0,05 mol

Do nCH2=CH-COOH > nCH2 ⇒ chỉ ghép CH2 vào axit

Phản ứng vừa đủ ⇒ nOH- = nCH2=CH-COOH = 0,05 mol

nKOH = 0,0125 mol; nNaOH = 0,0375 mol

Vậy: m = 0,05 ×71 + 0,02 ×14 + 0,0125×39 + 0,0375×23 = 5,18 gam

1,0

Câu 5

1

Theo bài ra: C7H8O2 có 2H linh động khi phản ứng với Na và 1H linh động khi phản ứng với NaOH 1-OH của ancol và 1-OH của phenol

HO-Ar-CH2-OH + CuO HO-Ar-CH=O + CuO + H2O

HO-Ar-CH=O + 4H2 HOC6H10CH2OH

HOC6H10CH2OH + 2CH3COOH (CH3COO)2(C6H10CH2)+2H2O

HO-Ar-CH2-OH + CH3COOH CH3COO-CH2-ArOH+H2O

1,0

2

Chất M: (C3H4O3)nC3n/2H5n/2(COOH)3n/2 5n/2+3n/2=2.3n/2+2 n=2

M là C6H8O6 hay C3H5(COOH)3 Công thức cấu tạo:

HOOCCH2CH2CH(COOH)2, HOOCCH(CH3)CH(COOH)2,

HOOCCH2CH(COOH)CH2COOH, (HOOC)3CCH2CH3

(HOOC)2C(CH3)CH2COOH

Chất N: (C2H3O3)m C2m-yH3m – (x+y)(OH)x(COOH)y

N là: C4H6O6 hay C2H2(OH)2(COOH)2 Công thức cấu tạo:

HOOCCH(OH)-CH(OH)COOH và (HOOC)2C(OH)CH2OH

1,0

3

RCHO + 2[Ag(NH3)2]OH RCOONH4 + 2Ag + 3NH3 + H2O (1)

HCHO + 4[Ag(NH3)2]OH (NH4)2CO3 + 4Ag + 6NH3 + 2H2O (2)

R-CHO  +  H2  R-CH2OH (3)

2 + H2O (4)

Nếu P không chứa HCHO nP = 0,5 mol.

= 10,4/0,5 = 20,8 ⇒ loại

Vậy P gồm HCHO (x mol) và CH3CHO (y mol)

Đặt HS của Z:H%h=H/100, nCH3OH(pư)=0,1mol, nC2H5OH (pư)=0,1hmol

Theo (4) : nH2O =1/2n

BTKL: 32.0,1 + 46.0,1h = 4,52 + 18.(0,05 + 0,05h) ⇒ h = 0,6H% = 60%

1,0

4

Pư: CxHyOz + (x +y/4 – z/2)O2 xCO2 + y/2H2O (1)

Do: X1 + NaOH 1 ancol ACOOB (x mol), BOOC-R-COOB (y mol)

ACOOB + NaOH ACOONa + BOH (2)

BOOC-R-COOB + 2NaOH R(COONa)2 + BOH (3)

ACOONa + NaOH AH + Na2CO3 (4)

R(COONa)2 + 2NaOH RH2 + 2Na2CO3 (5)

BOH + Na BONa + 1/2H2 (6)

Theo (1) : nH2O = 0,44 mol nO(X1)=0,57.2 + 0,44-0,66.2 = 0,26 mol

Theo (2,3): 2x+4y=0,26nNaOH ()=x +2y=0,13nNaOH dư=0,18mol

Do: nNaOH(2,3)=nNaOH(4,5)=0,13 mol nAH + nRH2 = x + y = 0,09

x = 0,05 và y = 0,04

Ta có: 0,13(B + 17) – 0,13.2/2 = 5,85 B = 29 BOH là C2H5OH

Ta có: 0,05(A + 73) + 0,04(R + 146) = 11,88, R=A–1A=27 là CH2=CH

Các este: CH2=CH-COOC2H5, C2H5OOC-CH=CH-COO-C2H5 (CisTrans)

và C2H5-OOC-C(=CH2)-COO-C2H5

1,0

Ghi chú: Thí sinh có thể làm cách khác, nếu đúng vẫn đạt điểm tối đa trong mỗi câu. Nếu thiếu điều kiện hoặc thiếu cân bằng hoặc thiếu cả hai thì trừ một nửa số điểm của PTHH đó. Làm tròn đến 0,25 điểm.

—————– HẾT —————–

VnDoc xin giới thiệu tới các em Đề thi chọn học sinh giỏi lớp 12 môn Hóa học năm 2019 sở GD&ĐT Quảng Trị có kèm theo đáp án. Hi vọng đây sẽ là tài liệu hữu ích hỗ trợ các em ôn luyện và đạt kết quả cao. Mời các em tham khảo thêm các tài liệu khác tại mục Tài liệu học tập lớp 12

 

O2 Education gửi các thầy cô link download đề thi

DE HSG QTRI 2020

 

Xem thêm


Comments

Leave a Reply

Your email address will not be published. Required fields are marked *