Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2016

Đề thi hsg lớp 12 môn hóa tỉnh Quảng Trị năm 2016

SỞ GIÁO DỤC VÀ ĐÀO TẠO

QUẢNG TRỊ

ĐỀ THI CHÍNH THỨC

(Đề thi có 02 trang)

KỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 12 THPT

Khóa thi ngày 02 tháng 3 năm 2016

Môn thi: HÓA HỌC

Thời gian làm bài: 180 phút, không kể thời gian giao đề

Câu 1. (4,0 điểm)

1. Nêu hiện tượng và viết phương trình phản ứng xảy ra dạng ion trong các thí nghiệm sau:

a) Cho từ từ đến dư dung dịch KHSO4 vào dung dịch chứa NaAlO2 và Na2CO3.

b) Cho dung dịch H2SO4 loãng vào dung dịch Fe(NO3)2.

c) Cho Fe3O4 tác dụng với dung dịch HI dư.

d) Sục khí CO2 đến dư vào dung dịch Ca(OH)2.

2. Hợp chất khí của nguyên tố R với hiđro có dạng H2R. Trong oxit cao nhất, R chiếm 40% về khối lượng. Ở trạng thái cơ bản, nguyên tử của nguyên tố M có 4 lớp electron và 4 electron độc thân. Hãy xác định tên các nguyên tố R và M.

3. Trong một bình nước có chứa 0,01 mol Na+, 0,02 mol Ca2+, 0,005 mol Mg2+, 0,05 mol HCO3 và 0,01 mol Cl.

a) Hãy cho biết nước trong bình có tính cứng tạm thời hay vĩnh cửu. Vì sao?

b) Đun sôi nước trong bình cho đến phản ứng hoàn toàn, hãy cho biết tính cứng của nước có thay đổi không?

4. Hòa tan hoàn toàn 66,2 gam hỗn hợp X gồm Fe3O4, Fe(NO3)2 và Al trong dung dịch chứa 3,1 mol KHSO4 (loãng). Sau phản ứng, thu được dung dịch Y chỉ chứa 466,6 gam muối sunfat trung hòa và 10,08 lít (đktc) khí Z gồm 2 khí trong đó có một khí hóa nâu ngoài không khí, tỉ khối của Z so với He là 23/18. Tính phần trăm khối lượng của Al trong hỗn hợp X.

Câu 2. (4,0 điểm)

1. Hoàn thành các phương trình phản ứng sau (biết tỉ lệ mol các chất đều là 1:1):

a) Dung dịch BaCl2 tác dụng với dung dịch NaHSO4.

b) Dung dịch Ba(HCO3)2 tác dụng với dung dịch KHSO4.

c) Dung dịch Ca(H2PO4)2 tác dụng với dung dịch KOH.

d) Dung dịch Ca(OH)2 tác dụng với dung dịch NaHCO3.

2. Hoà tan hoàn toàn 5,4 gam một kim loại R bằng dung dịch H2SO4 đặc nóng dư, thu được SO2 (sản phẩm khử duy nhất). Cho toàn bộ lượng khí này hấp thụ hết vào 350 ml dung dịch NaOH 2M. Sau phản ứng, cô cạn dung dịch thì thu được 41,8 gam chất rắn khan. Xác định R.

3. Sục khí A vào dung dịch chứa chất B ta được chất C rắn, màu vàng và dung dịch D. Khí X có màu vàng lục tác dụng với khí A tạo ra chất C và F. Nếu X tác dụng với khí A trong nước thì tạo ra chất Y và F, rồi thêm BaCl2 vào dung dịch thì có kết tủa trắng. A tác dụng với dung dịch chứa chất G là muối nitrat kim loại tạo ra kết tủa H màu đen. Đốt cháy chất H bởi oxi ta được chất lỏng I màu trắng bạc. Viết các phương trình phản ứng xảy ra.

4. Dung dịch A1 chứa NaOH 1M và Ba(OH)2 0,5M. Dung dịch B1 chứa AlCl3 1M và Al2(SO4)3 0,5M. Cho V1 lít dung dịch A1 vào V2 lít dung dịch B1 thu được 56,916 gam kết tủa. Nếu cho dung dịch BaCl2 dư vào V2 lít dung dịch B1 thu được 41,94 gam kết tủa.

Viết các phương trình phản ứng xảy ra dạng ion và tính giá trị của V1 và V2.

Câu 3. (4,0 điểm)

1. Hỗn hợp A gồm FexOy, FeCO3, RCO3 (R thuộc nhóm IIA). Hoà tan m gam A dùng vừa hết 245 ml dung dịch HCl 2 M. Mặt khác, đem hoà tan hết m gam A bằng dung dịch HNO3 được dung dịch B và 2,8 lít khí C (đktc) gồm NO (sản phẩm khử duy nhất) và CO2. Cho dung dịch B tác dụng hoàn toàn với dung dịch NaOH dư, thu được 21,69 gam kết tủa D. Chia D thành 2 phần bằng nhau. Nung phần 1 trong không khí đến khối lượng không đổi thu được 8,1 gam chất rắn chỉ gồm 2 oxit. Hoà tan hết phần 2 bằng dung dịch H2SO4 loãng vừa đủ được dung dịch G. Cho 23,1 gam bột Cu vào một nửa dung dịch G, sau khi phản ứng hoàn toàn lọc tách được 21,5 gam chất rắn.

Viết các phương trình phản ứng xảy ra và xác định FexOy, RCO3.

2. Aspirin (axit axetyl salixilic, o-CH3COO-C6H4-COOH) có tính axit yếu, hằng số cân bằng là 10-3,49, độ tan trong nước ở nhiệt độ phòng là 0,355 gam/100 gam H2O. Tính pH của dung dịch Aspirin bão hòa ở nhiệt độ phòng.

3. Trong bình kín thể tích là 10 lít chứa không khí (20% O2 và 80% N2 theo thể tích) và 1,54 gam chất X (chứa C, H, O, N; tương ứng với 0,02 mol, thể khí) ở áp suất P, nhiệt độ 54,60C. Bật tia lửa điện để đốt cháy hết X. Sau đó cho toàn bộ sản phẩm cháy qua lần lượt bình 1 đựng P2O5 dư, bình 2 đựng 400 ml dung dịch Ba(OH)2 0,075M và bình 3 đựng photpho dư đun nóng, khí còn lại là N2 có thể tích là 5,6 lít (đktc). Cho các phản ứng xảy ra hoàn toàn, hãy xác định giá trị của P. Biết bình 1 tăng 1,26 gam, bình 2 tạo 3,94 gam kết tủa và khi đun nóng dung dịch sau phản ứng lại có kết tủa xuất hiện, bình 3 tăng 0,16 gam.

Câu 4. (4,0 điểm)

1. Cho các chất: C6H5OH, C2H5OH, CH3COOH, C6H5ONa, C2H5ONa. Viết các phương trình phản ứng xảy ra (nếu có, trong điều kiện thích hợp) khi trộn các chất với nhau từng đôi một.

2. Hoàn thành các phương trình phản ứng theo sơ đồ chuyển hoá sau:

C11H21 O4N C5H7O4NNa2 (B) + C3H8O (C)

C5H10O4NCl (D) C3H6O (E) C3H9O2N (F)

Biết B là muối của một a– aminoaxit có mạch cacbon không phân nhánh.

3. Thủy phân hết 1 lượng pentapeptit X trong môi trường axit thu được 32,88 gam Ala–Gly–Ala–Gly, 10,85 gam Ala–Gly–Ala, 16,24 gam Ala–Gly–Gly, 26,28 gam Ala–Gly, 8,9 gam alanin còn lại là Gly–Gly và glyxin. Tỉ lệ số mol Gly–Gly:Gly là 10:1. Tính tổng khối lượng Gly–Gly và glyxin.

4. Đốt cháy hoàn toàn 7,6 gam hỗn hợp gồm một axit cacboxylic no, đơn chức, mạch hở và một ancol đơn chức thu được 0,3 mol CO2 và 0,4 mol H2O. Thực hiện phản ứng este hóa 7,6 gam hỗn hợp trên với hiệu suất 80% thu được m gam este. Viết các phương trình phản ứng và tính giá trị của m.

Câu 5. (4,0 điểm)

1. Bằng phương pháp hoá học, hãy nhận biết các dung dịch riêng biệt mất nhãn chứa các chất sau: HCOOH, CH3COOH, CH2=CH-COOH, H2N-CH2-COOH, C6H5NH2.

2. Hoàn thành các phương trình phản ứng theo sơ đồ chuyển hoá sau:

C3H6 X Y Z TE (đa chức).

3. Viết các phương trình hoá học trực tiếp điều chế các loại tơ sau: axetat, nilon-6,6, lapsan.

4. Thủy phân hoàn toàn hỗn hợp A gồm 2 este no, mạch hở (trong phân tử mỗi chất chỉ chứa nhóm chức este) bằng dung dịch NaOH vừa đủ. Chưng cất dung dịch sau phản ứng, thu được 12,3 gam muối khan B của một axit hữu cơ và hỗn hợp C gồm 2 ancol (số nguyên tử cacbon trong mỗi phân tử ancol không vượt quá 3). Đốt cháy hoàn toàn muối B trên, thu được 7,95 gam muối Na2CO3. Mặt khác, đốt cháy hoàn toàn hỗn hợp C trên, thu được 3,36 lít CO2 (đktc) và 4,32 gam H2O. Xác định công thức cấu tạo của 2 este.

Cho: H=1, C=12, N=14, O=16, Na=23, Mg=24, Al=27, K=39, S=32, Fe=56, Ba=137.

…………HẾT…………

Thí sinh được dùng bảng HTTH và tính tan

SỞ GIÁO DỤC VÀ ĐÀO TẠO

ĐỀ THI CHÍNH THỨC

HƯỚNG DẪN CHẤM

KỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 12 THPT

Khóa thi ngày 02 tháng 3 năm 2016

Môn thi: HÓA HỌC

Câu

Ý

Nội dung

Điểm

Câu 1

1

a) Tạo khí, kết tủa, rồi kết tủa tan

H+ + AlO2 + H2O Al(OH)3

Al(OH)3 + 3H+ Al3+ + H2O

H+ + CO32- HCO3

HCO3 + H+ CO2 + H2O

b) Tạo khí không màu, hóa nâu trong không khí

4H+ + 3Fe2+ + NO3 3Fe3+ + NO + 2H2O

c) Fe3O4 tan, tạo kết tủa

Fe3O4 + 8H+ + 2I 3Fe2+ + I2 + 4H2O

d) Tạo kết tủa trắng, rồi kết tủa tan

CO2 + 2OH + Ca2+ CaCO3 + H2O

CO2 + CaCO3 + H2O Ca2+ + HCO32-

1,0

2

Công thức oxit cao nhất của R là RO3

MR = 32 R là lưu huỳnh

Cấu hình electron của M là:

Có 26 proton M là Fe

1,0

3

a) Nước trong bình có tính cứng tạm thời và vĩnh cửu. Vì nước trong bình có chứa nhiều Ca2+ và Mg2+ dưới dạng muối HCO3 và Cl.

b) Đun sôi nước cho đến phản ứng hoàn toàn, ta được nước mềm.

Vì: 2 HCO3 CO32- + CO2 + H2O

CO32- + Ca2+ CaCO3

CO32- + Mg2+ MgCO3

Ion Ca2+ và Mg2+ tác dụng vừa đủ với CO32-

Dung dịch sau khi đun sôi chỉ chứa NaCl

1,0

4

Do MZ=46/9 → khí còn lại phải là H2 NO3 hết

Gọi a, b lần lượt là số mol của H2 và NO, ta có hệ:

Muối sunfat trung hòa: FeSO4, Fe2(SO4)3, (NH4)2SO4, K2SO4, Al2(SO4)3 
Theo ĐLBTKL: 66,2 + 3,1.136= 466,6 + 0,45.46/9 + mH2O mH2O=18,9 gam nH2O=1,05 mol
BTNT Hiđro: 3,1= 4x + 2.1,05 + 2.0,4x= 0,05 mol (nNH4+ = x mol) 
Vậy nNO3 = 0,05 + 0,05 = 0,1 mol nFe(NO3)2=0,05 mol 
BTNT Oxi: 4y + 0,05.6 = 1,05 + 0,05y = 0,2 mol ( y= nFe3O4)

  mAl = 66,2 – 0,2.232 – 180.0,05 = 10,8 gam 
Vậy %(m)
Al = (10,8. 100)/66,2 = 16,31%

1,0

Câu 2

1

BaCl2 + NaHSO4 BaSO4 + NaCl + HCl

Ba(HCO3)2 + KHSO4 BaSO4 + KHCO3 + CO2 + H2O

Ca(H2PO4)2 + KOH CaHPO4 + KH2PO4 + H2O

Ca(OH)2 + NaHCO3 CaCO3 + NaOH + H20

1,0

2

– Số mol NaOH = 0,35 . 2 = 0,7 mol

– Phản ứng: SO2 + NaOH NaHSO3

SO2 + 2NaOH Na2SO3 + H2O

Nếu chất rắn là Na2SO3 thì khối lượng là: 0,35 . 126 = 44,1 gam

Nếu chất rắn là NaHSO3 thì khối lượng là: 0,7. 104 = 72,8 gam

Chất rắn thu được khi cô cạn dung dịch là 41,8 gam < (44,1; 72,8)

Chất rắn thu được gồm Na2SO3 và NaOH dư

– Đặt số mol của Na2SO3 là x Số mol NaOH dư là 0,7-2.x

Ta có: 126.x + (0,7-2x) . 40 = 41,8 → x = 0,3 mol

Phản ứng: 2R + 2nH2SO4 đặc R2(SO4)n + nSO2 + 2nH2O

nR = mol MR = 9n R là Al (nhôm)

1,0

3

H2S + 2FeCl3 2FeCl2 + S + 2HCl (1)

Cl2 + H2S S + 2HCl (2)

4Cl2 + H2S + 4H2O 8HCl + H2SO4 (3)

BaCl2 + H2SO4 BaSO4 + 2HCl (4)

H2S + Hg(NO3)2 HgS + 2HNO3 (5)

HgS + O2 Hg + SO2 (6)

1,0

4

– Phản ứng:

Ba2+ + SO42- BaSO4 (1)

Al3+ + 3OH Al(OH)3 (2)

Al(OH)3 + OH AlO2 + H2O (3)

– Trong V1 lít A1 có OH: 2V1 mol, Ba2+ : 0,5V1 mol

Trong V2 lít B1 có Al3+ : 2V2 mol, SO42- : 1,5V2 mol

– Khi cho V2 lít tác dụng với dung dịch BaCl2 dư thì:

n(SO42-)=n(BaSO4)=0,18 molV2=0,12 lít

B1: Al3+: 0,24 mol và SO42-: 0,18 mol

* Trường hợp 1: Nếu 2V1>0,24. 3 kết tủa tan một phần

nBaSO4= 0,18 mol nAl(OH)3=(56,916 – 233.0,18)/78=0,192

nOH =2V1= 4. 0,24 – 0,192 V1=0,384 lít
* Trường hợp 2: Nếu 2V1 0,24. 3 kết tủa chưa tan

nBaSO4= 0,5V1 mol (SO42- đủ hay dư) nAl(OH)3=(56,916 – 116,5V1)/78

(56,916- 116,5V1)3/78=2V1 V1=0,338 lít

1,0

Câu 3

1

Các phương trình phản ứng xảy ra:

FexOy + 2yHCl xFeCl2y/x + yH2O

FeCO3 + 2HCl FeCl2 + CO2 + HO

RCO3 + 2HCl RCl2 + CO2 + H2O

3FexOy + (12x – 2y)HNO3 3xFe(NO3)2+ (3x – 2y)NO +(6x – y)H2O

3FeCO3 + 10HNO3 3Fe(NO3)3 + NO +3CO2 + 5H2O

RCO3 + 2HNO3 R(NO3)2 + CO2 + H2O

Fe(NO3)3 + 3NaOH Fe(OH)3 + 3NaNO3

R(NO3)2 + 2NaOH R(OH)2 + 2NaNO3

2Fe(OH)3 Fe2O3 + 3H2O

R(OH)2 RO + H2O

2Fe(OH)3 + 3H2SO4 Fe2(SO4)3 + 6H2O

R(OH)2 + H2SO4 RSO4 + 2H2O

Fe2(SO4)3 + Cu 2FeSO4 + CuSO4

Gọi a, b lần lượt là số mol của Fe(OH)3 và M(OH)2, do nung kết tủa tạo hỗn hợp oxit nên M(OH)2 không tan trong nước, gọi z, t lần lượt là số mol của FexOy và FeCO3 trong m gam hỗn hợp A

Theo các phương trình phản ứng, bài ra và áp dụng ĐLBT ta có các hệ:

Vậy công thức của oxit và muối cacbonat là: Fe3O4 và MgCO3.

2,0

2

Kí hiệu aspirin là HA [HA] = 0,355.1000/180.100 = 1,97.10-2M

HA H+ + A ; Ka = 10-3,49

0,5

3

Bình chứa P2O5 hấp thu H2O

Bình chứa P hấp tụ O2 0,16 gam

Bình chứa Ca(OH)2 hấp thụ CO2,

Do tạo kết tủa và đun dung dịch lại xuất hiện kết tủa tạo 2 muối

CO2 + Ba(OH)2 BaCO3 + H2O (1)

0,03 0,03 0,03

BaCO3 + CO2 + H2O Ba(HCO3)2 (2)

(0,03-0,1) 0,1

Suy ra 0,04 mol

(không khí)= hoặc 29

Sơ đồ: X + không khí CO2 + H2O + N2 (1)

Áp dụng ĐLBTKL: mX+ mkk=+ + + (dư)

1,54 + x.28.8 = 0,04.44+1,26+0,16 +0,25.28 x=0,3 mol

P=0,86 atm

1,5

Câu 4

1

CH3COOH + C2H5OH CH3COOC2H5 + H2O

CH3COOH + C6H5ONa CH3COONa + C6H5OH

CH3COOH + C2H5ONa CH3COONa + C2H5OH

C6H5OH + C2H5ONa C6H5ONa + C2H5OH

1,0

2

H3C-[CH2]2-OOC­CH(NH2)[CH2]2COO-[CH2]2CH3 + 2 NaOH

2CH3-CH2­CH2OH + NaOOC-CH(NH2)[CH2]2COONa

NaOOC-CH[CH2]2COONa+3HCl®HOOC-CH(NH3Cl)[CH2]2COOH+ 2NaCl

CH3-CH2­CH2OH + CuO CH3-CH2­CHO + Cu + H2O

C2H5­CHO+ 2[Ag(NH3)2]OH C2H5COONH4 + 2Ag + 3NH3 + H2O

1,0

3

Ala-Gly-Ala-Gly : 0,12 mol, Ala-Gly-Ala: 0,05 mol, Ala-Gly-Gly: 0,08 mol

Ala-Gly: 0,18 mol, Ala: 0,1 mol, Gly-Gly : 10x, Gly: x

Þ penta peptit có dạng : Ala-Gly-Ala-Gly-Gly: a mol

Theo ĐLBT: 2a = 2.0,12+ 2.0,05 + 0,08 + 0,18 + 0,1 Þ a = 0,35 mol

3a = 2.0,12 + 0,05+ 2.0,08 + 0,18 + 21x Þ x = 0,02 mol

Tổng khối lượng Gly-Gly và Gly là: 10. 0,02.132 + 0,02.75 = 27,9 gam

1,0

4

Khi đốt: nH2O>nCO2Ancol no, đơn, hở n(ancol)=0,40,3 = 0,1 (mol)

Gọi công thức CnH2n+2O (R/OH), CmH2mO2 (RCOOH)

CnH2n+2O + O2 nCO2 + (n + 1) H2O (1)

CmH2mO2 + O2 mCO2 + mH2O (2)

RCOOH + R/OH RCOOR/ + H2O (3)

n < 0,3/0,1 = 3 n = 1 hoặc 2

Trường hợp 1: n=1 CH3OH m(axit) = 7,6 – 0,1.32 = 4,4 gam

Ta có: nCO2 (2) = 0,3 – 0,1 = 0,2 mol m = 4

Axit là C3H7COOH: 0,05 mol.

Do n(axit) = 0,05 < n(ancol) = 0,1 molm(este)= 0,05.80.102/100 = 4,08 g

Trường hợp 2: n=2 C2H5OH m(axit) = 7,6 – 0,1.46 = 3 gam

Ta có: nCO2 (2) = 0,3– 0,2= 0,1 molError: Reference source not found m= 2

Axit là CH3COOH: 0,05 molm(este)= 0,05.80.88/100 = 3,52 gam

1,0

Câu 5

1

-Dùng quỳ tím ta nhận biết được 3 nhóm chất

Nhóm 1: HCOOH, CH3COOH, CH2= CH-COOH làm đỏ quỳ tím

Nhóm 2: H2N-CH2-COOH, C6H5NH2 không đổi màu quỳ tím

-Trong nhóm 1: Dùng AgNO3/NH3 nhận biết HCOOH do tạo kết tủa Ag

HCOOH + 2[Ag(NH3)2]OH (NH4)2CO3 + 2Ag + 2NH3 + H2O

-Hai dung dịch axit còn lại dùng dd brom để nhận biết CH2= CH-COOH do hiện tượng làm mất màu dd brom, còn lại là dd CH3COOH.

CH2= CH-COOH + Br2 CH2Br- CHBr- COOH

-Trong nhóm 2: H2N-CH2-COOH, C6H5NH2

Dùng dd brom để nhận biết C6H5NH2 tạo kết tủa, còn lại là H2N-CH2-COOH

C6H5NH2 + 3Br2 H2NC6H2Br3 + HBr

1,0

2

C3H6 (xiclopropan) + Br2 Br-CH2CH2CH2Br

Br-CH2CH2CH2Br + 2NaOH HO-CH2CH2CH2OH + 2 NaCl

HO-CH2CH2CH2OH + 2CuO O=HC-CH2CH=O + 2Cu + 2H2O

O=HC-CH2CH=O + O2 HOOCCH2COOH

HOOCCH2COOH+CH3OH CH3OOCCH2COOCH3+H2O

1,0

3

nHOOC-C6H4-COOH + nHO-CH2-CH2-OH

(-CO-C6H4-CO-O-CH2-CH2-O-)n + nH2O

[C6H7O2(OH)3]n + 2n(CH3CO)2O

[C6H7O2(OH)(OCOCH3)2]n + 2nCH3COOH

[C6H7O2(OH)3]n +3 n(CH3CO)2O

[C6H7O2(OCOCH3)3]n + 3nCH3COOH

nHOOC-(CH2)4-COOH + nH2N-(CH2)6-NH2

(-OC-[CH2]4-CO-HN-[CH2]6-NH-)n + 2nH2O

1,0

4

Tìm B:

Ta có

Vì A gồm 2 este no, mạch hởÞC gồm các ancol no, hở Þ C là

Vì , hỗn hợp X mạch hở, chỉ chứa nhóm chức este

Þ Hỗn hợp C có ít nhất 1 ancol đa chức

Þ Axit tạo muối B là đơn chức, Gọi B là RCOONa

Þ R = 15, R là CH3, muối B là CH3COONa

Tìm các chất trong hỗn hợp C

Vì và số nt cacbon trong mỗi ancol 3Þ CT của 1 ancol là CH3OH

Þ ancol còn lại là ancol đa chức: C2H4(OH)2 hoặc C3H8Oz (z=2 hoặc 3)

TH1: Nếu 2 ancol là CH3OH và C2H4(OH)2, Gọi x và y là số mol của 2 ancol tương ứng

Þ nNaOH = x + 2y = 0,15 (thỏa mãn)

Þ CTCT của 2 este là CH3COOCH3 và (CH3COO)2C2H4

TH2: Nếu 2 ancol là CH3OH và C3H8-z(OH)z, Gọi a và b là số mol của 2 ancol tương ứng

Þ nNaOH = a + zb = 0,06 + 0,03z=0,15 Þ z = 3

Þ CTCT của 2 este là CH3COOCH3 và (CH3COO)3C3H5

1,0

Thí sinh có thể làm cách khác, nếu đúng vẫn đạt điểm tối đa trong mỗi câu. Nếu thiếu điều kiện hoặc thiếu cân bằng hoặc thiếu cả hai thì trừ một nửa số điểm của PTHH đó.

– Làm tròn đến 0,25 điểm.

………………………HẾT…………………….

 

O2 Education gửi các thầy cô link download đề thi

de-thi-hsg-mon-hoa-hoc-lop-12-tinh-quang-tri-nam-2015-2016

 

Xem thêm