0

Đề thi HSG môn hoá lớp 11 tỉnh Vĩnh Phúc năm 2019

Đề thi HSG môn hoá lớp 11 tỉnh Vĩnh Phúc năm 2019

SỞ GD&ĐT VĨNH PHÚC

ĐỀ CHÍNH THỨC

KÌ THI CHỌN HSG LỚP 10, 11 THPT NĂM HỌC 2018 2019

ĐỀ THI MÔN: HÓA HỌC 11 – THPT

Thời gian làm bài: 180 phút, không kể thời gian phát đề.

(Đề thi gồm 02 trang)

Cho biết nguyên tử khối của các nguyên tố:

H = 1; He = 4; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; P = 31; S = 32; Cl = 35,5; K=39;

Ca = 40; Fe = 56; Cu = 64; Zn = 65; Br = 80; Ag = 108; Ba = 137.

Câu 1: Viết phương trình phản ứng theo sơ đồ sau (ghi rõ điều kiện phản ứng nếu có):

Câu 2: Nêu hiện tượng và viết phương trình phản ứng xảy ra trong các thí nghiệm sau:

a. Sục từ từ khí CO2 đến dư vào dung dịch nước vôi trong.

b. Sục khí NH3 đến dư vào dung dịch Cu(NO3)2.

c. Nhỏ từ từ dung dịch NaOH vào dung dịch HCl (có nhỏ vài giọt phenolphtalein).

d. Sục khí CO2 đến dư vào dung dịch natri aluminat.

e. Cho CH3CHO tác dụng với dung dịch AgNO3/NH3.

g. Cho một mẩu kim loại Na tác dụng với glixerol.

Câu 3:

1. Đơn chất X ở dạng bột màu đỏ, khi đun nóng X với HNO3 đặc, thu được khí T màu nâu đỏ và dung dịch Z. Tuỳ theo lượng NaOH cho vào Z, thu được muối Z1, Z2 hoặc Z3 (là các muối của kim loại Na). Viết các phương trình phản ứng xảy ra.

2. Khí A không màu, mùi khai, khi cháy trong khí oxi, thu được khí B không màu, không mùi. B tác dụng với kim loại Li ở nhiệt độ thường, thu được chất rắn C. Hoà tan C vào nước, thu được khí A. A tác dụng axit mạnh D, thu được muối E. Dung dịch muối E không tạo kết tủa với BaCl2 và AgNO3. Nung muối E trong bình kín, sau đó làm lạnh, thu được khí F và chất lỏng G.

Xác định các chất A, B, C, D, E, F, G và viết các phương trình phản ứng xảy ra.

Câu 4:

1. Axit linoleic chiếm khoảng 90% lượng axit béo omega-6 và có công thức cấu tạo:

CH3[CH2]4CH=CH-CH2-CH=CH[CH2]7COOH. Viết các đồng phân hình học của axit linoleic.

2. Ankan A (chất khí ở điều kiện thường) tác dụng với hơi brom đun nóng, thu được hỗn hợp X chứa một số dẫn xuất brom, trong đó dẫn xuất chứa nhiều brom nhất có tỉ khối hơi so với hiđro bằng 101. Xác định công thức phân tử của A và viết công thức cấu tạo các chất có trong X.

Câu 5: Hấp thụ hết 5,6 lít khí CO2 (đktc) vào dung dịch chứa x mol KOH và y mol K2CO3, thu được 250 ml dung dịch X. Cho từ từ đến hết 125 ml X vào 375 ml dung dịch HCl 0,5M, thu được 3,36 lít khí (đktc). Mặt khác, cho 125 ml X tác dụng với dung dịch Ba(OH)2 dư, thu được 49,25 gam kết tủa. Tính các giá trị của x và y.

Câu 6: Hỗn hợp khí A gồm 2 hiđrocacbon X và Y (đều mạch hở, MX < MY). Cho 268,8 ml A từ từ qua dung dịch nước brom dư, thấy có 3,2 gam brom phản ứng và không có khí thoát ra. Khi đốt cháy 268,8 ml A, thu được 1,408 gam CO­­2. Biết thể tích khí đo ở điều kiện tiêu chuẩn.

Xác định công thức phân tử của X, Y và tính phần trăm số mol của X, Y trong A.

Câu 7: Nhúng thanh Mg có khối lượng m gam vào dung dịch X chứa a mol Cu(NO3)2 và b mol HCl. Đồ thị biểu diễn sự phụ thuộc của khối lượng thanh Mg vào thời gian phản ứng được biểu diễn như hình vẽ dưới đây:

Biết NO là sản phẩm khử duy nhất của N+5.

a. Viết các phương trình phản ứng xảy ra theo đúng thứ tự phản ứng.

b. Tính các giá trị của a, b và tổng thể tích các khí thu được (đktc).

Câu 8: Viết phương trình phản ứng để hoàn thành các sơ đồ chuyển hóa sau:

(1): C4H10 X1 + X2

(2): X1 X3 + X4

(3): X3 X5

(4): X5 + X2 X6

(5): X6 + Cl2 X7 + …

(6): X7 + Cl2 X8 + …

(7): X8 + NaOH loãng, dư X9 + ….

(8): X8 + NaOH đặc, dư X10 + ….+ ….

Biết: X7 X8 đều là sản phẩm chính và chứa vòng benzen; X3 tạo kết tủa vàng khi tác dụng với dung dịch AgNO3/ NH3 dư.

Câu 9: Hỗn hợp M gồm 3 ancol đều đơn chức, mạch hở X, Y và Z (có số nguyên tử cacbon liên tiếp nhau; X, Y đều no, Z không no có 1 liên kết C=C và MX < MY < MZ). Đốt cháy hoàn toàn a gam M, thu được 45,024 lít CO2 (đktc) và 46,44 gam H2O. Mặt khác, 2a gam M phản ứng vừa đủ với 32 gam Br2 trong dung dịch. Đun nóng a gam M với H2SO4 đặc ở 1400C, thu được 18,752 gam hỗn hợp T gồm 6 ete. Đốt cháy hoàn toàn T, thu được 1,106 mol CO2 và 1,252 mol H2O.

Tính hiệu suất tạo ete của X, Y, Z.

Câu 10: Hòa tan hoàn toàn 36,05 gam hỗn hợp A gồm Fe2O3, Fe(NO3)2, Zn bằng 960 ml dung dịch HCl 1M. Sau phản ứng thu được dung dịch X chứa 61,17 gam chất tan và 2,24 lít (đktc) hỗn hợp khí gồm N2O, NO và H2 có tỉ khối so với He bằng 6,8. Cho AgNO3 dư vào X, thu được 0,224 lít khí NO (đktc) và 145,32 gam kết tủa. Tính phần trăm khối lượng của Fe(NO3)2 trong A.

………………………………Hết………………………………..

Thí sinh không được sử dụng tài liệu. Cán bộ coi thi không giải thích gì thêm.

Họ và tên thí sinh: ………………………………………….Số báo danh: ……………………………

SỞ GD&ĐT VĨNH PHÚC

KỲ THI CHỌN HSG LỚP 10, 11 THPT

Năm học: 2018 – 2019

HƯỚNG DẪN CHẤM MÔN: HÓA HỌC 11 – THPT

(Hướng dẫn chấm gồm 04 trang)

CÂU

Ý

NỘI DUNG

ĐIỂM

Câu 1

(2,0đ)

(1): N2 + 3H2 2NH3

0,25

(2): 4NH3 + 5O2 4NO + 6H2O

0,25

(3): 2NO + O2 2NO2

0,25

(4): 4NO2 + O2 + 2H2O 4HNO3

0,25

(5): 5Mg + 12 HNO3 5Mg(NO3)2 + N2 + 6H2O

0,25

(6): N2 + O2 2NO

0,25

(7): 2NO2 + 2NaOH NaNO2 + NaNO3 + H2O

0,25

(8): 5NaNO2 + 2NaMnO4 + 3H2SO4 5NaNO3 + Na2SO4 + 2MnSO4 +3H2O

0,25

Câu 2

(2,0đ)

a.

Có kết tủa trắng, sau tan dần tạo dung dịch trong suốt:

CO2 + Ca(OH)2 → CaCO3 ↓+ H2O

CO2 + CaCO3 ↓ + H2O → Ca(HCO3)2

0,5

b.

Có kết tủa xanh, sau tan thành dung dịch xanh thẫm:

2NH3 + Cu(NO3)2 + 2H2O → Cu(OH)­2 ↓ + 2NH4NO3

4NH3 + Cu(OH)2 ↓ → [Cu(NH3)4 ] (OH)2

0,5

c.

Dung dịch không màu, sau xuất hiện màu hồng:

NaOH + HCl → NaCl + H2O; NaOH dư → Na+ + OH

0,25

d.

Có kết tủa keo trắng:

CO2 + NaAlO2 + 2H2O → NaHCO3 + Al(OH)3

0,25

e.

Có kết tủa Ag:

CH3CHO + 2AgNO3 + 3NH3 + H2O→ CH3COONH4 + 2NH4NO3 + 2 Ag ↓.

0,25

g.

Có bọt khí thoát ra:

2C3H5(OH)3 + 6Na → 2C3H5(ONa)3 + 3H2

0,25

Câu 3

(2,0đ)

1.

X là photpho, các phản ứng xảy ra:

P + 5HNO3 → H3PO4 (Z) + 5NO2↑ (T) + H2O

0,25

H3PO4 + NaOH → NaH2PO4 (Z1) + H2O

0,25

H3PO4 + 2NaOH → Na2HPO4 (Z2) + 2H2O

0,25

H3PO4 + 3NaOH → Na3PO4 (Z3) + 3H2O

0,25

2.

A: NH3; B: N­2; C: Li3N; D: HNO3; E: NH4NO3; F: N2O; G : H2O

4NH3 + 3O2 2N2 + 6H2O

N2 + 6Li 2Li3N

0,5

Li3N + 3H2O NH3 + 3LiOH

NH3 + HNO3 NH4NO

NH4NO N2O + 2H2O

0,5

Câu 4

(2,0đ)

1.

cis-cis

0,25

cis – trans

0,25

trans-cis

0,25

trans-trans

0,25

2.

a. Đặt công thức phân tử của ankan A là : (n nguyên dương).

0,25

Theo bài ra: 14.n + 2 – x + 80.x = 101.2 (1) (x, n : nguyên dương)

Từ (1) → x ≤ 2 → Nghiệm thỏa mãn là: x = 2 và n = 3.

Vậy CTPT của A là .

0,25

b. Trong X có chứa 6 dẫn xuất Brom: CH2Br-CH2-CH3; CH3-CHBr-CH3;

CHBr2-CH2-CH3; CH2Br-CHBr-CH3; CH2Br-CH2-CH2Br; CH3-CBr2-CH3.

(Nếu viết đúng ít hơn 6 đồng phân cho 0,25 điểm)

0,5

Câu 5

(2,0đ)

CO2 + 2OH → CO32- + H2O(1); CO2 + CO32- + H2O → 2HCO3(2).

Trong dung dịch X có: CO32- , HCO3 , K+.

* Cho từ từ X+ HCl xảy ra đồng thời 2 phản ứng :

0,5

Đặt phản ứng = a mol; phản ứng = b mol ( trong 125 ml X)

.

0,5

* X+­ Ba(OH)2 dư : HCO3 + OH + Ba2+ → BaCO3 + H2O

 ∑nC (125 ml X) = n = 0,25 mol => ∑n C(250 ml X) = 0,5 mol. Bảo toàn C => y = 0,25 mol.

0,5

250 ml X có: 0,125 mol và 0,375 mol

Bảo toàn điện tích cho X => nK+ = 0,625 mol.

Bảo toàn nguyên tố K=> x = 0,625 – 0,25 × 2 = 0,125 mol.

0,5

Câu 6

(2,0đ)

(

(2

(

nA = 0,012 mol; = 0,02 mol; = 0,032 mol.

Cho A + Br2 không thấy khí thoát ra khỏi bình → chứng tỏ X, Y không no.

Số liên kết trung bình= => = 0,012 0,02 → =

=>1 chất có 1 liên kết và 1 chất có a liên kết , a .

Số => số => Trong A có X là C2H4 hoặc C2H2.

0,5

* Trường hợp 1: X là C2H4 và Y là CnH4 ( 3 ≤ n ≤ 4; có a liên kết π)

  • X là C2H4 và Y là C3H4 :

1mol A có:

0,5

  • X là C2H4 và Y là C4H4 :

1 mol A có:

0,25

* Trường hợp 2: X là C2H2 và Y là CnH2n ( 3 ≤ n ≤ 4; có 1 liên kết π)

1mol A có:

0,25

=> số

0,5

Câu 7

(2,0đ)

a.

Thứ tự các phản ứng xảy ra:

3Mg + 8H+ + 2NO3 → 3Mg2+ + 2NO↑ + 4H2O (1)

Mg + Cu2+ → Mg2+ + Cu↓ (2)

Mg + 2H+ → Mg2+ + H2 (3)

0,5

b.

Giai đoạn 1: xảy ra phản ứng (1)

m thanh Mg phản ứng = 18 gam => n Mg phản ứng = 0,75 mol.

n H+ pư = 2,0 mol ; => a = 0,25 mol.

0,5

Giai đoạn 3: xảy ra phản ứng (3)

m thanh Mg phản ứng = 6 gam => n Mg phản ứng = 0,25 mol.

=> phản ứng = 0,5 mol => b = 0,5 + 2,0 = 2,5 mol.

0,5

n H2 = 0,25 mol => ∑ 0,75 mol => Vkhí = 16,8 lít.

0,5

Câu 8

(2,0đ)

(1): C4H10 CH4 (X1) + C3H6 (X2)

0,25

(2): 2 CH4 (X1) C2H2 (X3) + 3 H2 (X4)

0,25

(3): 3 C2H2 (X3) C6H6 (X5)

0,25

(4): C6H6 (X5) + C3H6 (X2) C6H5-CH(CH3)2 (X6)

0,25

(5): C6H5-CH(CH3)2 (X6) + Cl2 C6H5-CCl(CH3)2 (X7) + HCl

0,25

(6): C6H5-CCl(CH3)2 (X7) + Cl2 p-Cl-C6H4-CCl(CH3)2 (X8) + HCl

0,25

(7): p-Cl-C6H4-CCl(CH3)2 (X8) + NaOH loãng p-Cl-C6H4-COH(CH3)2 (X9) + NaCl

0,25

(8): p-Cl-C6H4-CCl(CH3)2 (X8) + NaOH đặc, dư

p-NaO-C6H4-COH(CH3)2 (X10) + 2NaCl + H2O

0,25

Câu 9

(2,0đ)

Trong a gam M có: nX = x mol, nY = y mol, nZ = z mol.

* Phản ứng cháy : 2,01 mol ; 2,58 mol → x + y = 0,57.

0,25

* Tác dụng với Br2 => z = 0,1 mol => nM = x + y + z = 0,67 => Số .

0,25

X, Y, Z có số nguyên tử C liên tiếp nhau và MX < MY < MZ

=> X là C2H5OH; Y là C3H7OH và Z là C4H7OH.

0,25

Ta có hệ phương trình:

0,25

* 18,752 gam ete T1,106 mol CO2 + 1,252 mol H2O

Đặt số mol phản ứng: => tách ra =

Ta có hệ phương trình:

0,5

Hiệu suất tạo ete của các ancol: HX = 50%; HY = 60%; HZ = 40%.

0,5

Câu 10

(2,0đ)

= 0,01.4 = 0,04 mol. Bảo toàn Cl: n AgCl = 0,96 mol =>

0,25

Bảo toàn e => =+ 3 = 0,07 + 3. 0,01=0,10 mol.

Bảo toàn khối lượng => 7,2 gam => 0,4 mol.

0,25

=> hệ phương trình:

0,25

Bảo toàn điện tích cho dung dịch X:

0,25

Bảo toàn H

= 0,1 – (0,06 – 2d) = (0,04 + 2d) mol

0,25

Bảo toàn oxi ta có: (IV)

0,25

Giải hệ (I → IV) được: a = 0,04 mol; b = 0,06 mol; c = 0,29 mol; d = 0,02 mol.

0,25

=> = 29,96%.

0,25

Học sinh làm cách khác, nếu đúng vẫn cho điểm tối đa

 

O2 Education gửi các thầy cô link download file word đề và đáp án đề thi

Vĩnh Phúc 2018-2019

 

Xem thêm

Tổng hợp đề thi HSG lớp 12 môn hoá học

Tổng hợp các phương pháp giải bài tập môn hoá học

Tổng hợp đề thi THPT QG 2021 file word có lời giải chi tiết

Polime

Leave a Reply

Your email address will not be published. Required fields are marked *