Đề thi hsg lớp 12 môn hóa tỉnh Ninh Bình năm 2012

Đề thi hsg lớp 12 môn hóa tỉnh Ninh Bình năm 2012

ĐỀ CHÍNH THỨC

SỞ GD&ĐT TỈNH NINH BÌNH

ĐỀ THI CHỌN HỌC SINH GIỎI LỚP 12 THPT (lần 1)

NĂM HỌC 2011 – 2012

Môn: Hóa học – Ngày thi thứ nhất

Thời gian làm bài 180 phút (không kể thời gian giao đề)

(Đề thi gồm 09 câu trong 02 trang)

Câu 1 (2,5 điểm):

Dẫn hỗn hợp khí gồm: N2, O2, NO2 vào dung dịch NaOH dư, được dung dịch D và thừa lại một chất khí không bị hấp thụ. Cho D tác dụng với dung dịch KMnO4 (trong môi trường H2SO4) thấy dung dịch KMnO4 mất màu, thu được dung dịch G. Cho vụn Cu vào dung dịch G, đun thì thấy dung dịch có màu xanh và một chất khí thoát ra bị hóa nâu ngoài không khí. Giải thích hiện tượng và viết các phương trình hóa học.

Câu 2 (2,0 điểm):

1. Chỉ dùng dung dịch NH3, hãy phân biệt các dung dịch sau: AlCl3, ZnCl2, NaOH, MgCl2.

2. Hòa tan hoàn toàn một mẩu Al trong dd HNO3 ta chỉ thu được dung dịch X. Nhỏ từ từ tới dư dung dịch NaOH vào dung dịch X. Viết các phương trình hóa học xảy ra dưới dạng ion thu gọn.

Câu 3 (2,5 điểm):

Có 200ml dung dịch hỗn hợp gồm CuSO4 0,25M và CrCl2 0,6M. Điện phân dung dịch trên trong thời gian 1 giờ 36 phút 30 giây với I = 5A.

1. Tính khối lượng kim loại bám vào catốt.

2. Tính thể tích khí bay lên ở anốt (ở đktc).

3. Dung dịch còn lại có những chất nào? Tính của chúng (giả sử thể tích dung dịch không đổi).

Câu 4 (1,0 điểm):

T

In

rong bảng dưới đây có ghi các năng lượng ion hoá liên tiếp In (n = 1, …, 6) theo kJ.mol1 của 2 nguyên tố X và Y:

Nguyên tố

I1

I2

I3

I4

I5

I6

X

590

1146

4941

6485

8142

10519

Y

1086

2352

4619

6221

37820

47260

A và B là những oxit tương ứng của X và Y khi X, Y ở vào trạng thái oxi hoá cao nhất.

Viết công thức của hợp chất tạo thành khi cho A tác dụng với B.

Câu 5 (2,5 điểm):

Trong số các cacbonyl halogenua COX2 người ta chỉ điều chế được 3 chất: COF2 (cacbonyl florua); COCl2 (cacbonyl clorua) và COBr2 (cacbonyl bromua).

1. Vì sao không có hợp chất COI2 (cacbonyl iođua)?

2. So sánh góc liên kết ở các phân tử cacbonyl halogenua đã biết.

3. So sánh nhiệt tạo thành tiêu chuẩn Hotth của COF2 (khí) và COCl2 (khí).

4. Sục khí COCl2 từ từ qua dung dịch NaOH ở nhiệt độ thường. Viết phương trình hóa học xảy ra (nếu có).

Câu 6 (2,0 điểm):

Hoà tan hết 0,660 gam một axit hữu cơ đơn chức (viết tắt là HA) vào nước đến mức 50,0 ml, được dung dịch A. Tiến hành chuẩn độ dung dịch A bằng dung dịch chuẩn NaOH 0,125 M. Biết rằng: khi thêm 25,0 ml dung dịch NaOH vào dung dịch A thì pH của dung dịch thu được bằng 4,68; khi thêm 60,0 ml dung dịch NaOH vào dung dịch A thì đạt tới điểm tương đương.

1. Tính khối lượng mol của axit HA.

2. Tính hằng số axit Ka của HA.

Câu 7 (2,5 điểm):

Khi nhiệt phân các hợp chất (A), (B), (C), (D) người ta thu được các sản phẩm khác nhau. Hãy viết công thức và tên sản phẩm; giải thích (dùng mũi tên cong) vì sao có sự tạo thành các sản phẩm đó.

1. (A) CH3CH2COOCH2CH2CH2CH3

2. (B) CH3[CH2]5CH(OH)CH2CH=CH[CH2]7COOH

3. (C) (CH3)3CCH(CH3)OCSSCH3

4. (D) CH3[CH2]3C(OH)(CH3)CH2CH=CH[CH2]3COOCH(CH3)[CH2]3CH3

Câu 8 (2,5 điểm):

Ala, Val, Leu là chữ viết tắt tên các aminoaxit thiên nhiên, công thức lần lượt là CH3CH(NH2)COOH, (CH3)2CHCH(NH2)COOH, (CH3)2CHCH2CH(NH2)COOH.

1. Viết các phương trình phản ứng tổng hợp tripeptit Leu-Ala-Val từ các chất: Ala, Val, Leu, photpho pentaclorua, Boc-Cl (tert-butyloxicacbonyl clorua), ancol benzylic, DCC (đixiclohexylcacbođiimit), axit trifloaxetic, axit axetic, hiđro, palađi và cacbon.

2. Có bao nhiêu tripeptit được tạo thành mà mỗi tripeptit có đủ 3 aminoaxit trên, nếu không sử dụng nhóm bảo vệ.

3. Biểu diễn công thức phối cảnh của tripeptit Leu-Ala-Val.

4. Ghi giá trị pKa vào nhóm tương ứng và tính pHI của tripeptit này, biết rằng pKa1 = 3,42; pKa2 = 7,94.

Câu 9 (2,5 điểm):

Lin (linamarin) và Lac (lactrin) là các xiano glucozit thiên nhiên. Khi thuỷ phân Lin, Lac trong môi trường axit thì Lin tạo ra D-glucozơ, axeton và HCN; còn Lac tạo ra D-glucozơ, HCN và benzanđehit.

Xác định cấu trúc của Lin và Lac ở dạng bền nhất. Viết cơ chế phản ứng thuỷ phân Lin, Lac.

(Cho: Cu = 64; Cr = 52)

—————Hết————–

Họ và tên thí sinh :……………………………………………….Số báo danh ……………………………………….

Giám thị 1: Họ và tên:………………………………………….Chữ ký………………………………………

Giám thị 2: Họ và tên:………………………………………….Chữ ký………………………………………

 

O2 Education gửi các thầy cô link download đề thi

2011-2012 Đề

 

Các thầy cô có thể xem thêm nhiều đề thi hsg của các tỉnh khác tại

Tổng hợp đề thi HSG lớp 12 môn hoá học

 

Hoặc xem thêm các tài liệu khác của môn hóa