Giáo án dạy thêm hóa học lớp 12 theo tuần cả năm học và bản in cho HS

Giáo án dạy thêm hóa học lớp 12 theo tuần cả năm học và bản in cho HS

 

 

BẢN GIÁO ÁN

Ngày soạn:

CHỦ ĐỀ 1: ESTE – LIPIT (3 tuần)

Tuần 1: ESTE (1)

Tuần 1:

Kiến thức

Khái niệm, đặc điểm cấu tạo phân tử, danh pháp (gốc – chức) của este.

Tính chất hoá học : Phản ứng thuỷ phân (xúc tác axit) và phản ứng với dung dịch kiềm (phản ứng xà phòng hoá).

Phương pháp điều chế bằng phản ứng este hoá.

Ứng dụng của một số este tiêu biểu.

Hiểu được : Este không tan trong n­ước và có nhiệt độ sôi thấp hơn axit đồng phân.

Kĩ năng

Viết được công thức cấu tạo của este có tối đa 4 nguyên tử cacbon.

Viết các phương trình hoá học minh hoạ tính chất hoá học của este no, đơn chức.

Phân biệt được este với các chất khác như ancol, axit,… bằng phương pháp hoá học.

Tính khối lượng các chất trong phản ứng xà phòng hoá.

NỘI DUNG

I. LÝ THUYẾT

1. Cấu tạo phân tử của este

( R, R’ là các gốc hidrocacbon; R có thể là H, R’ khác H)

Khi thay nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR thì được este.

  1. Gọi tên

Tên este RCOOR’ = tên gốc hiđrocacbon R’ + tên gốc axit RCOO- (đuôi at)

Tên gọi một số axit và gốc hiđrocacbon thường gặp

Axit Gốc hiđrocacbon

HCOOH axit fomic CH3– metyl

CH3COOH axit axetic C2H5– etyl

C2H5COOH axit propionic CH3-CH2-CH2– propyl

C2H3COOH axit acrylic (CH3)2CH- isopropyl

CH2=C(CH3)COOH axit metacylic CH2=CH- vinyl

C6H5COOH axit bezoic CH2=CH-CH2– anlyl

HOOC-COOH axit oxalic C6H5– phenyl

(CH3)2CHCOOH axit isobutiric C6H5-CH2– benzyl

HOOC(CH2)4COOH axit ađipic CH3(CH2)3– butyl

p-HOOC-C6H4-COOH axit terephtaric (CH3)2CH-CH2- isobutyl

CH3CH2CH(CH3)- sec-butyl

(CH3)3C- tert-butyl

CH3(CH2)16COOH C17H35COOH axit stearic

CH3(CH2)14COOH C15H31COOH axit panmitic

CH3(CH2)7CH=CH(CH2)7COOH C17H33COOH axit oleic

CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH C17H31COOH axit linoleic

  1. Tính chất vật lý

– Các este thường là các chất lỏng dễ bay hơi, ít tan trong nước, có mùi thơm đặc trưng.

– t0s (hiđrocacbon) < t0s (este, anddehit, xeton) < t0s (ancol) < t0s (của axit)

  1. Tính chất hóa học

A. Phản ứng thủy phân:

Môi trường axit:

R-COO-R+ H-OH R –COOH + ROH

Môi trường kiềm (phản ứng xà phòng hóa)

R-COO-R+ Na-OH R –COONa + ROH

(Thủy phân este no, đơn chức mạch hở trong môi trường axit là phản ứng thuận nghịch, môi trường kiềm là phản ứng 1 chiều)

Chú ý:

Khi thủy phân các este của phenol:

R-COO-C6H5 + 2NaOH R-COO-Na + C6H5ONa + H2O

Khi thủy phân một số este đặc biệt:

R-COO-CH=CH-R’ + NaOH R-COO-Na + RCH2CHO

Vd: CH3-COO-CH=CH-CH3 + NaOH R-COO-Na + CH3CH2CHO

Vd:

(Nếu sản phẩm phản ứng thủy phân là muối natri của axit fomic HCOONa, anđehit thì 2 sản phẩm đó thực hiện được phản ứng tráng bạc – tác dụng với ddAgNO3/NH3)

b. tính chất khác: Các este có gốc hidrocacbon không no

b.1. Este của axit fomic HCOOR có phản ứng tráng bạc – tác dụng với ddAgNO3/NH­3

b.2. Phản ứng trùng hợp tại gốc hidrocacbon

b.3. Phản ứng cộng ( với H2 ; halogen)

VD: CH3COOCH=CH2 + H2 CH3COOCH2-CH3

  1. Điều chế

RCOOH + ROH RCOOR + H2O

(Muốn cân bằng chuyển dịch theo chiều tạo ra este nên lấy dư axit hoặc dư ancol và chưng cất để tách este ra khỏi hệ)

Chú ý: Để điều chế vinyl axetat thì cho axit axetic tác dụng với axetilen

CH3COOH + CHCH CH3COOCH=CH2

Để điều chế este của phenol cho anhiđrit axit tác dụng với phenol
(CH
3CO)2O + C6H5OH CH3COOC6H5 + CH3COOH

Một số lưu ý khi làm bài tập
– Este no, đơn chức mạch hở có CTPT CnH2nO2 (n2)

– Đốt cháy este thu được số mol CO2 = số mol H2O este là no, đơn chức, mạch hở (đặt CTPT là CnH2nO2)

– Este tham gia phản ứng với NaOH (KOH) theo tỷ lệ 1:2 thì este là este của phenol hoặc este 2 chức.

– Các gốc R, R’ thường gặp CH3 ( 15), C2H5– (29), C2H3– (27), CH3COONa = 82, C2H5OH =46…

– Chất có công thức phân tử dạng CnH2nO2 có thể là

+ Este no, đơn chức, mạch hở

+ Axit cacboxylic no, đơn chức mạch hở

+ HCHC tạp chức gồm chức ancol (hoặc ete) với và anđehit (hoặc xeton)…

– Este RCOOR’ R’OCOR R’OOCR

– Thủy phân este trong môi trường bazơ
+ Thông thường thu được muối và ancol

+ Thu được muối và anđehit este đơn chức có dạng R-COO-CH=CH-R’

+ Thu được muối và xeton este đơn chức có dạng R-COO-C(R1)=CH-R2 O

+ Thu được 2 muối và H2O este đơn chức có dạng R-COO-C6H4-R’

+ Thu được 1 chất (hữu cơ) duy nhất este đơn chức có dạng vòng R – C=O

+ Thu được 1 muối, 1 anđehit, H2O este đa chức có dạng (RCOO)2CH-R’

Yêu cầu:

– Nắm vững khái niệm, cách gọi tên, tcvl, tchh, phương pháp điều chế, một số ứng dụng của este.
– Từ 1 CTPT tính được độ BBH k biện luận các loại HCHC có thể có và viết đầy đủ các đồng phân este.

– Gọi tên thành thạo các este thường dùng.

– Nắm vững các trường hợp ancol không bền để viết đúng các pthh của phản ứng thủy phân các este.

– Lựa chọn được cách đặt công thức (CTPT, CTCT) của một este hợp lý.

– Tìm được phương pháp giải phù hợp đối với mỗi bài toán.

Các dạng bài tập chính:

– Xác định CTPT dựa vào phản ứng cháy

– Xác định CTCT dựa vào phản ứng thủy phân

– Kết hợp giữa phản ứng thủy phân và phản ứng cháy

– Điều chế este.

II. MỘT SÔ CÂU HỎI TRẮC NGHIỆM

Câu 1: Công thức tổng quát của este tạo bởi axit no đơn chức, mạch hở và ancol no, đơn chức. mạch hở có dạng:

A. CnH2n-2O2 (n ≥ 3). B. CnH2nO2 (n ≥ 2). C. CnH2nO2 (n ≥ 3). D. CnH2n-2O2 (n ≥ 4).

Câu 2: Este có CTPT C3H6O2 có số đồng phân là:

A. 4. B. 5. C. 3. D. 2.

Câu 3: Vinyl axetat là tên gọi của hợp chất nào sau đây ?

A. HCOOC2H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. CH3COOCH=CH2.

Câu 4: Phenyl axetat là tên gọi của hợp chất nào sau đây ?

A. CH3COOC6H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. CH3COOCH=CH2.

Câu 5: Metyl propionat là tên gọi của hợp chất nào sau đây ?

A. HCOOC2H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. HCOOCH=CH2.

Câu 6: Hợp chất X có CTPT C4H8O2. Khi thủy phân X trong dd NaOH thu được muối C2H3O2Na. CTCT của X là:

A. HCOOC3H7. B. C2H5COOCH3. C. CH3COOC2H5. D. C3H7COOH.

Câu 7: Hợp chất X có CTPT C4H8O2. Khi thủy phân X trong dd NaOH thu được muối CHO2Na. CTCT của X là:

A. HCOOC3H7. B. C2H5COOCH3. C. CH3COOC2H5. D. C3H7COOH.

Câu 8: Thuỷ phân hỗn hợp metyl axetat và etyl axetat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol. C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 9: Khi nói về este vinyl axetat, mệnh đề nào sau đây không đúng?

A. Xà phòng hóa cho ra 1 muối và 1 anđehit.

B. Không thể điều chế trực tiếp từ axit hữu cơ và ancol.

C. Vinyl axetat là một este không no, đơn chức.

D. Thuỷ phân este trên thu được axit axetic và axetilen.

Câu 10: Este C4H8O2 có gốc ancol là metyl thì axit tạo nên este đó là:

A. axit oxalic. B. axit butiric. C. axit propionic. D. axit axetic.

Câu 11: Este C4H8O2 có gốc ancol là etyl thì axit tạo nên este đó là:

A. axit oxalic. B. axit butiric. C. axit propionic. D. axit axetic.

*Câu 12: Cặp chất nào sau đây dùng để điều chế vinylaxetat bằng một phản ứng trực tiếp?

A. CH3COOH và C2H3OH. B. C2H3COOH và CH3OH.

C. CH3COOH và C2H2. D. CH3COOH và C2H5OH.

*Câu 13: Cho este CH3COOC6H5 tác dụng với dd KOH dư. Sau phản ứng thu được muối hữu cơ gồm:

A. CH3COOK và C6H5OH. B. CH3COOK và C6H5OK.

C. CH3COOH và C6H5OH. D. CH3COOH và C6H5OK.

Câu 14: Tên gọi của este có mạch cacbon thẳng, có thể tham gia phản ứng tráng bạc, có CTPT C4H8O2

A. propyl fomat. B. isopropyl fomat. C. etyl axetat. D. metyl propionat.

Câu 15: Phát biểu nào sau đây đúng ?

A. este nhẹ hơn nước và tan nhiều trong nước.

B. este no, đơn chức, mạch hở có công thức CnH2nO2 (n ≥ 2).

C. phản ứng thủy phân este trong môi trường kiềm là phản ứng thuận nghịch.

D. đốt cháy este no, đơn chức, mạch hở thu được nCO2>nH2O.

Câu 16: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là

A. HCOOH < CH3COOH < C2H5OH. B. CH3COOCH3 < C2H5OH < CH3COOH.

C. CH3OH < CH3COOH < C2H5OH. D. HCOOH < CH3OH < CH3COOH

Câu 17: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là

A. HCOOH < CH3COOH < C2H5OH < CH3CHO.

B. C2H6 < HCOOCH3 < C2H5OH < CH3COOH.

C. CH3CHO < CH3OH < CH3COOH < C2H5OH.

D. CH3CHO < HCOOH < CH3OH < CH3COOH.

Câu 18: Phản ứng thủy phân este trong môi trường kiềm được gọi là phản ứng:

A. Xà phòng hóa B. Hidrat hóa C. Crackinh D. Sự lên men

*Câu 19: Cho các chất: C6H5OH, HCHO, CH3CH2OH, C2H5OC2H5, CH3COCH3, HCOOCH3, CH3COOCH3, CH3COOH, HCOOH, HCOONa tác dụng với dd AgNO3/NH3, đun nóng. Số phản ứng xảy ra là:

A. 2. B.3. C. 4. D. 5.

*Câu 20: Cho các chất lỏng nguyên chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH lần lượt tác dụng với Na. Số phản ứng xảy ra là:

A. 2. B. 3. C. 4. D. 5.

*Câu 21: Cho lần lượt các chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH tác dụng với dd NaOH, đun nóng. Số phản ứng xảy ra là:

A. 2. B. 3. C. 4. D. 5.

Câu 22: Phát biểu nào sau không đây đúng?

A. este nhẹ hơn nước và không tan trong nước.

B. este no, đơn chức, mạch hở có công thức CnH2nO2 (n ≥ 2).

C. phản ứng thủy phân este trong môi trường kiềm là phản ứng xà phòng hóa.

D. đốt cháy este no, đơn chức, mạch hở thu được nCO2>nH2O.

Câu 23: Thuỷ phân hỗn hợp metyl axetat và etyl fomat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol. C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 24: Este nào sau đây thủy phân trong môi trường axit cho hỗn hợp 2 chất hữu cơ đều tham gia p.ứ tráng bạc ?

A. CH3COOC2H5. B. HCOOCH=CH2. C. HCOOC3H7. D. CH3COOC6H5.

*Câu 25: Chất nào sau đây không tạo este với axit axetic?

A. C2H5OH B. C3H5(OH)3. C. C2H2 D. C6H5OH

Câu 26: Thuỷ phân hỗn hợp metyl axetat và metyl fomat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol. C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 27: Thủy phân vinylaxetat bằng dd KOH vừa đủ. Sản phẩm thu được là

A. CH3COOK, CH2=CH-OH. B. CH3COOK, CH3CHO.

C. CH3COOH, CH3CHO. D. CH3COOK, CH3CH2OH.

Câu 28: Đốt cháy một este hữu cơ X thu được 13,2g CO2 và 5,4g H2O. X thuộc loại este

A. no, đơn chức, mạch hở. B. mạch vòng, đơn chức .

C. hai chức, no, mạch hở. D. có 1 liên kết đôi, chưa xác định nhóm chức.

Câu 29: Este nào sau đây thủy phân trong môi trường axit cho 2 chất hữu cơ đều không tham gia phản ứng tráng bạc ?

A. HCOOC6H5. B. CH3COOCH=CH2. C. CH3COOC2H5. D. HCOOCH=CH2.

*Câu 30: Este CH3COOCH=CH2 tác dụng được với chất nào sau đây ?

A. H2/Ni,t0. B. Br2. C. NaOH. D. Tất cả đều đúng.

Câu 31: Đặc điểm của phản ứng thủy phân este no, đơn chức, mạch hở trong môi trường axit là:

A. thuận nghịch. B. một chiều. C. luôn sinh ra muối và ancol D. xảy ra nhanh ở nhiệt độ thường.

Câu 32: Cho các chất sau: CH3COOCH3 (1), CH3COOH (2), HCOOC2H5 (3), CH3CHO (4). Chất nào khi tác dụng với NaOH cho cùng một loại muối là CH3COONa ?

A. (1), (4). B. (2), (4). C. (1), (2). D. (1), (3).

Câu 33: Chất nào sau đây có nhiệt độ sôi thấp nhất ?

A. C4H9OH. B. C3H7COOH. C. CH3COOC2H5. D. C6H5OH.

*Câu 34: Cho các chất lỏng nguyên chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH lần lượt tác dụng với Na. Số chất tác dụng với NaOH nhưng không tác dụng với Na là:

A. 2. B. 3. C. 4. D. 5.

Câu 35: Este X có CTPT là C3H6O2 , có khả năng tham gia phản ứng tráng bạc. Công thức cấu tạo của X là:

A. CH3COOCH3. B. CH3COOC2H5. C. C2H5COOH. D. HCOOC2H5.

*Câu 36: Phát biểu nào sau đây không đúng ?

A. CH3COO-CH=CH2 có thể trùng hợp tạo polime.

B. CH3COO-CH=CH2 tác dụng được với dd Br2 hoặc cộng H2/Ni,t0.

C. CH3COO-CH=CH2 tác dụng với NaOH thu được muối và anđehit.

D. CH3COO-CH=CH2 cùng dãy đồng đẳng với CH2=CH-COOCH3.

Câu 37: Đốt cháy hoàn toàn este no, đơn chức, mạch hở X, thể tích CO2 sinh ra bằng thể tích O2 phản ứng (ở cùng điều kiện). Este X là:

A. metyl axetat B. metyl fomat. C. etyl axetat. D. metyl propionat.

Câu 38: Este có CTPT C4H8O2 có số đồng phân là:

A. 4. B. 5. C. 3. D. 2.

Câu 39: Este X có CTPT là C4H8O2 tạo bởi axit propionic và ancol Y. Ancol Y là:

A. ancol metylic. B. ancol etylic. C. ancol propylic. D. ancol butylic.

Câu 40: Phản ứng giữa axit cacboxylic với ancol được gọi là:

A. phản ứng trung hòa. B. phản ứng hidro hóa.

C. phản ứng este hóa. D. phản ứng xà phòng hóa.

Câu 41: Phát biểu nào sau đây không đúng?

A. Phản ứng este hóa luôn xảy ra hoàn toàn.

B. Khi thủy phân este no, đơn chức mạch hở trong môi trường axit sẽ cho axit và ancol.

C. Phản ứng giữa axit và ancol là phản ứng thuận nghịch.

D. Khi thủy phân este no, đơn chức, mạch hở trong môi trường kiềm sẽ cho muối và ancol.

Câu 42: Mệnh đề nào sau đây không đúng?

A. Metyl fomat có CTPT là C2H4O2. B. Metyl fomat là este của axit etanoic.

C. Metyl fomat có thể tham gia phản ứng tráng bạc.

D. Thuỷ phân metyl fomat trong môi trường axit tạo thành ancol metylic và axit fomic.

*Câu 43: Metyl acrylat có công thức cấu tạo thu gọn là

A. C2H5COOCH3. B. CH3COOC2H5. C. CH2=CHCOOCH3. D. CH3COOCH3.

Câu 44: Phát biểu nào sau đây không đúng ?

A. Hợp chất CH3COOC2H5 thuộc loại este.

B. este no, đơn chức, mạch hở có công thức phân tử là CnH2nO2 (n ≥ 2).

C. Este là h.chất hữu cơ trong p.tử có nhóm COO.

D. Sản phẩm hữu cơ của p.ư giữa axit cacboxylic và ancol là este.

* Bài tập trắc nghiệm

Câu 1: Chất nào dưới đây không phải là este?

A. HCOOCH3 B. CH3COOH C. CH3COOCH3 D. HCOOC6H5

Câu 2: Cho các chất có công thức cấu tạo sau đây: (1) CH3CH2COOCH3, (2) CH3OOCCH3, (3) HCOOC2H5, (4) CH3COOH, (5) CH3CH(COOCH3)(COOC2H5), (6) HOOCCH2CH2OH, (7) CH3OOC−COOC2H5. Những chất thuộc loại este là:

A. (1), (2), (3), (4), (5), (6) B. (1), (2), (3), (5), (7)

C. (1), (2), (4), (6), (7) D. (1), (2), (3), (6), (7)

Câu 3 : Hợp chất X có công thức cấu tạo CH3OOCCH2CH3. Tên gọi của X là:

A. etyl axetat B. metyl propionat C. metyl axetat D. propyl axetat

Câu 4: Este C4H8O2 tham gia phản ứng tráng bạc có thể có tên sau

A. Etyl fomat B. Propyl fomat C. Isopropyl fomat D. B, C đều đúng

Câu 5: X, Y là hỗn hợp 2 este đồng phân được tạo thành từ một cùng một ancol đơn chức với hai axit đơn chức đồng phân của nhau. Tỉ khối hơi của hỗn hợp so với hiđro bằng 51. Công thức phân tử của X, Y là

A. C3H6O2 B. C4H8O2 C. C5H10O2 D. C6H12O2

Câu 6 A08: Số đồng phân este ứng với công thức phân tử C4H8O2

A. 5. B. 2. C. 4. D. 6.

Câu 7: Số đồng phân este mạch hở ứng với công thức phân tử C4H6O2 là:

A. 5 B. 2 C. 4 D. 6

HD: Sử dụng mạch cacbon của este có công thức C4H8O2 sau đó điền thêm liên kết đôi.

Câu 8: C4H6O2 có bao nhiêu đồng phân cấu tạo mạch hở phản ứng được với dung dịch NaOH?

A. 7 B. 8 C. 5 D. 6

HD: Tính cả đồng phân este và axit cacboxylic

Câu 9: Số đồng phân mạch hở đơn chức ứng với công thức phân tử C4H8O2 tác dụng với NaOH là:

A. 5 B. 2 C. 4 D. 6

Câu 10: Số hợp chất đơn chức, đồng phân cấu tạo của nhau có cùng công thức phân tử C4H8O2, đều tác dụng với dung dịch NaOH không tác dụng với Na là

A. 3 B. 4 C. 5 D. 6

HD: Chỉ tính các đồng phân este

Câu 11: Hai este đơn chức X và Y là đồng phân của nhau. Khi hoá hơi 1,85 gam X, thu được thể tích hơi đúng bằng thể tích của 0,7 gam N2 ( đo ở cùng điều kiện). Công thức cấu tạo thu gọn của X, Y là

A.C2H5COOCH3 và HCOOCH(CH3)2 B. HCOOC2H5 và CH3COOCH3

C.C2H3COOC2H5 và C2H5COOC2H3 D.HCOOCH2CH2CH3 và CH3COOC2H5

Câu 12: Đốt chất X có M=74 thu được CO2 và H2O. X mạch hở tác dụng với Na, NaHCO3 , AgNO3/NH3. Công thức của X là ?

A. C4H10O B. C3H6O2 C. C2H2O3 D. Tất cả sai

Câu 13: Cho sơ đồ phản ứng :

(1) X + Br2 + H2O axit cacboxylic Y1 + HBr
(2) X + H
2 ancol Y2 (3) Y1 + Y2 Y3 + H2O

Biết Y3 có công thức phân tử C6H10O2. Tên gọi của X là:

A. anđehit acrylic B. anđehit propionic C. anđehit metacrylic D. andehit axetic

Câu 14: A13 Cho sơ đồ các phản ứng:

X + NaOH (dung dịch) Y + Z; Y + NaOH (rắn) T + P;

T Q + H2; Q + H2O Z.

Trong sơ đồ trên, X và Z lần lượt là

A. HCOOCH=CH2 và HCHO B. CH3COOC2H5 và CH3CHO

C. CH3COOCH=CH2 và CH3CHO D. CH3COOCH=CH2 và HCHO

Câu 15: Chất nào có nhiệt độ sôi thấp nhất?

A. HCOOC2H5 B. HCOOH C. CH3COOC2H5 D. CH3OH

Câu 16: Cho các chất: CH3OH, CH3COOCH3, CH3COOH, C2H3COOCH3, C2H5OH, HCOOH. Sắp xếp các chất sau theo nhiệt độ sôi tăng dần theo thứ tự

A. CH3OH, HCOOH, C2H5OH, CH3COOH, CH3COOCH3, C2H3COOCH3

B. CH3COOCH3, C2H3COOCH3, CH3OH, HCOOH, CH3COOH, C2H5OH

C. C2H3COOCH3, CH3COOCH3, CH3OH, HCOOH, C2H5OH, CH3COOH

D. CH3COOCH3, C2H3COOCH3, CH3OH, C2H5OH, HCOOH, CH3COOH

C. Rút kinh nghiệm

Ngày

Tổ trưởng kí duyệt

Nguyễn Thị Hương

Ngày soạn:

Tuần 2: ESTE

A. MỤC TIÊU

Rèn luyện kĩ năng

– Viết CTCT các chất đồng phân.

– Xác định CTPT este qua phản ứng cháy.

B. NỘI DUNG

GV nhắc lại lý thuyết và cho HS làm bài tập tự luận

*Bài tập tự luận

Bài 1: Viết công thức cấu tạo và gọi tên các este có công thức phân tử C3H6O2, C4H8O2, este thơm có CTPT C8H8O2.

HD: C3H6O2 có 2 CTCT HCOOCH2CH3 etyl fomat

CH3COOCH3 metyl axetat

C4H8O2 có 4 CTCT HCOOCH2CH2CH3 propyl fomat

HCOOCH(CH3)2 isopropyl fomat
CH3COOCH2CH3 etyl fomat

CH3CH2COOCH3 metyl propionat

C8H8O2 có 6 CTCT o, m, p – HCOOC6H4CH3

HCOOCH2C6H4

CH3COOC6H5

C6H5COOCH3

Bài 2: Gọi tên hoặc cho biết CTCT của các este sau (C6H5 là vòng benzen)

a. CH2=CHCOOCH3 (HD: metyl acrylat)

b. Phenyl axetat (HD: CH3COOC6H5)

c. HCOOCH2C6H5 (HD: benzyl fomat)
d. CH3COOCH=CH2 (HD: vinyl axetat)

e. CH3CH2COOCH2CH3 (HD: etyl propionat)

f. Metyl benzoat (HD: C6H5COOCH3)

DẠNG 1: TÌM CTPT CỦA ESTE NO, ĐƠN CHỨC (CnH2nO2) DỰA VÀO PỨ ĐỐT CHÁY

Chú ý: Đối với este no, đơn chức, mach hở khi đốt cháy luôn cho số mol CO2 = số mol H2O

Dựa vào phương trình đốt cháy ta có thể tính được số mol este đốt cháy theo CO2 hoặc H2O.

Từ đó tính được M → CTPT của este

Câu 1: Đốt cháy hoàn toàn 0,15 mol este thu được 19,8g CO2 và 0,45 mol H­2O. Công thức phân tử este là

A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C5H10O2

Câu 2: Đốt cháy hoàn toàn 3,7g một este đơn chức X thu được 3,36 lit khí CO2 (đktc) và 2,7g nước. CTPT của X là:

A. C2HO2 B. C3H6O2 C. C4H8O2 D. C5H8O2

Câu 3: Đốt cháy hoàn toàn một este no, đơn chức rồi dẫn sản phẩm cháy qua bình đựng KOH dư, thấy khối lượng bình tăng 9,3 gam. Số mol CO2 và H2O sinh ra lần lượt là:

A. 0,1 và 0,1. B. 0,15 và 0,15. C. 0,25 và 0,05. D. 0,05 và 0,25.

Câu 4: Đốt cháy hoàn 4,4 gam một este no, đơn chức, mạch hở A, rồi dẫn sản phẩm cháy qua bình đựng nước vôi trong dư thu được 20 gam kết tủa. Công thức phân tử của A là:

A. C2H4O2. B. C3H6O2. C. C5H10O2. D. C4H8O2.

Câu 5: Đốt cháy hoàn 4,08 gam một este no, đơn chức mạch hở A, rồi dẫn sản phẩm cháy qua bình đựng nước vôi trong thu được 10 gam kết tủa và ddX. Đung kỹ ddX thu được 5 gam kết tủa nữa. Công thức phân tử của A là:

A. C5H10O2. B. C3H6O2. C. C3H4O2. D. C4H6O2.

* Bài tập trắc nghiệm về nhà

Câu 1: Este X (C4H8O2) thoả mãn các điều kiện: X Y1 + Y2 và Y1 Y2. X có tên là

A. isopropyl fomat B. Propyl fomat C. metyl propionat D. etyl axetat

Câu 2: Thuỷ phân este C2H5COOCH=CH2 trong môi trường axit tạo sản phẩm

A. C2H5COOH, CH2=CH-OH B. C2H5COOH, HCHO

C. C2H5COOH, CH3CHO D. C2H5COOH, CH3CH2OH

Câu 3: Thủy phân este A trong môi trường axit thu được hỗn hợp 2 chất đều tham gia phản ứng tráng gương. Công thức cấu tạo của A là

A. CH3COOCH=CH2 B. HCOOCH2CH=CH2

C. HCOOC(CH3)=CH2 D. HCOOCH=CH-CH3

Câu 4 : Có bao nhiêu este mạch hở có công thức phân tử C5H8O2 khi xà phòng hoá tạo ra anđehit (không kể đồng phân hình học)

A. 1 B. 2 C. 3 D. 4

Câu 5: Thuỷ phân hoàn toàn một este đơn chức có tỉ khối hơi so với không khí bằng 4 bằng dung dịch NaOH thì thu được muối có khối lượng phân tử bằng 24/29 khối lượng phân tử este. Công thức của este là

A. C4H9COOCH3 B. C3H7COOC2H5 C. C2H5COOC2H5 D. C2H5COOC3H7

HD: đặt CTPT RCOOR’

Viết pthh và dựa vào công thức tỷ khối

Câu 6: Đun nóng 8,8 gam este B có công thức C4H8O2 với 200 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được 12,2 gam chất rắn. Tên gọi của B là

A. propyl fomat B. etyl axetat C. metyl propionat D. metyl axetat

HD: Đề bài cho chất rắn, có thể có NaOH dư, so sánh số mol NaOH và số mol este

Câu 7: X là một este no đơn chức, có tỉ khối hơi so với CH4 là 5,5. Nếu đem đun 2,2 gam este X với NaOH dư, thu được 2,05 gam muối. Công thức ancol tạo nên X là

A. C2H5COOCH3 B. CH3COOH C. C2H5OH D. CH3COOC2H5

HD: từ tỉ khối hơi tính được phân tử khối este suy ra CTPT este

Viết pthh thủy phân tính theo pt

Câu 8: Este đơn chức X có tỉ khối hơi so với CH4 là 6,25.Cho 20 gam X tác dụng với 300 ml dung dịch KOH 1M. Cô cạn dung dịch được sau phản ứng thu được 28 gam chất rắn khan. Công thức cấu tạo của X

A. CH2=CH-CH2COOCH3 B. CH2=CH-COOCH2CH3

C. CH3COOCH=CH-CH3 D. CH3-CH2COOCH=CH2

HD: Kết hợp cách làm của câu 6 và câu 7. Chú ý đề bài cho chất rắn khan

Câu 9: Để thuỷ phân hoàn toàn 4,64 gam một este đơn chức X thì cần 40ml dung dịch NaOH 1M. Sau phản ứng, thu được muối Y và ancol Z. Đốt cháy hoàn toàn 0,5 mol Z thì thu được 22,4 lít CO2 (đktc). Công thức đúng của X là

A. HCOOC5H11 B. C3H7COOC2H5 C. C2H5COOC3H7 D. C2H5COOC2H5

HD: dựa vào pư cháy của ancol tính được số C của ancol suy ra ancol

Từ phản ứng thủy phân tính được CTPT
Kết hợp 2 dữ kiện tìm được CTCT

Câu 10 : Một este đơn chức, mạch hở có khối lượng là 12,9 gam tác dụng vừa đủ với 150 ml dung dịch KOH 1M. Sau phản ứng thu được một muối và một anđehit. Công thức của este là

A. HCOOCH=CH−CH3 B. CH3COOCH=CH2

C. C2H5COOCH=CH2 D. HCOOCH=CH−CH3 và CH3COOCH=CH2

HD: Viết pthh của phản ứng thủy phân tính theo pthh tìm được CTPT

Biện luận từ CTPT tìm được kết quả

C. Rút kinh nghiệm

Ngày

Tổ trưởng kí duyệt

Nguyễn Thị Hương

Ngày soạn:

Tuần 3: ESTE

A. MỤC TIÊU

Rèn luyện kĩ năng

– Xác định CTCT este qua phản ứng thủy phân, tính toán lượng chất trong phản ứng cháy và phản ứng thuỷ phân.

B. NỘI DUNG

GV nhắc lại lý thuyết và cho HS làm bài tập tự luận

*Bài tập tự luận

* Bài tập tự luận

Bài 1: Cho biết tên hoặc công thức và viết pthh của p.ứng thủy phân các este sau trong môi trường kiềm (NaOH):
1. Metyl axetat 2. CH3COOCH=CH2

3. Etyl acylat 4. C6H5COOCH2CH3
5. Isopropyl fomat 6. CH3CH2COOC6H5

7. Anlyl benzoat 8. CH2=CHCOOC2H5

9. Vinyl propionat 10. HCOOCH3

11. Phenyl axetat 12. HCOOCH(CH3)2

13. Benzyl fomat 14. CH3COOCH2C6H5

HS viết phương trình thủy phân các chất vận dụng phần lý thuyết đã nhắc lại

Bài 2: Viết pthh của pư xảy ra khi cho các chất sau tác dụng với dd KOH (đun nóng)

1. HCOOCH2CH2OOCCH3. 2. CH3COOCH2CH2OOCCH3.

3. HCOOCH2CH2CH2OOCH. 4. HCOOCH2CH(CH3)OOCH.

5. CH3COO–(CH2)2–COOC2H5. 6. CH3OOC–(CH2)2–COOC2H5.

7. CH3OOC–CH2–COO–C2H5. 8. CH3COO–(CH2)2–OOCC2H5.

9. CH3COOC(CH3)=CH2. 10. HCOOCH=CHCH2CH3.

11. HCOOCH2CH=CHCH3. 12. HCOOC(CH3)=CHCH3.

13. CH3OCO-CH2-COOC2H5. 14. C2H5OCO-COOCH3.

15. CH3OCO-COOC3H7. 16. CH3OCO-CH2-CH2-COOC2H5.

17. HCOOCH2COOC2H5 18. CH3COOCH2CH2COOC6H5

19. CH3COOCH2OCOCH3 20. CH3COOCH(CH3)OCOC2H5

21. C6H5OCO-COOC6H5 22. C6H5COOCH=CHCH2OCOCH3

23. 24. 25.

HD: Các este ở ý 9, 10, 11, 12, 23, 24 ,25 là các este đơn chức td với KOH tỷ lệ 1:1, este ở ý 18 thủy phân với tỷ lệ 1:3, este ở ý 21 thủy phân với tỷ lệ 1:4, este ở các ý 9, 10, 12, 19, 20 thủy phân tạo thành sản phẩm không bền.

23. + KOH HOCH2CH2CH2COOK

24. + KOH HOCH2CH2CH(CH3)COOK

25. + KOH HOCH2CH2CH2CH2 OOK

Bài 3: Hoàn thành các phương trình phản ứng sau:

1. Este + NaOH CH3COONa + CH3CHO

2. Este + NaOH CH2(COONa)2 + CH3OH + C2H5OH

3. Este + NaOH CH3COONa + C2H5COONa + C2H4(OH)2

4. Este + NaOH HOCH2CH(CH3)CH(CH3)CH2COONa

5. Este + NaOH (COONa)2 + CH3CHO + C2H5OH

6. Este + NaOH C6H5COONa + CH3CH2COCH3

7. Este + NaOH HCOONa + CH3C6H4ONa + H2O

8. Este + NaOH CH3COONa + HCHO + H2O

9. Este + NaOH HCOONa + C6H4(ONa)2 + H2O

10. Este + NaOH CH3COONa + HCOONa + HOCH2C6H4ONa + H2O

HD: Ý 2 (bài 2 ý 6), ý 3 (bài 2 ý 1), ý 4 ( bài 2 ý 23, 24, 25), ý 5 (bài 1 ý 2), ý 6 (bài 2 ý 12), ý 7 (bài 1 ý 11)

Bài 4: Hoàn thành các phản ứng theo sơ đồ sau (dưới dạng công thức cấu tạo).

1. C3H4O2 + NaOH (A) + (B)

2. (A) + H2SO4 (loãng) (C) + (D)

3. (C) + AgNO3 + NH3 + H2O (E) + Ag + NH4NO3

4. (B) + AgNO3 + NH3 + H2O (F) + Ag + NH4NO3

HD: C3H4O2 có CTCT HCOOCH=CH2, A là HCOONa, B: CH3CHO, C: HCOOH, D: Na2SO4,

E: HO-COONH4, F: CH3COONH4

Bài 5: Hoàn thành các sơ đồ phản ứng sau:

HD: X: CH3COOCH=CH2, A: CH3CHO, B: CH3COONa, C: CH3COOH, D: C2H2, E: C2H4, G: C4H6

DẠNG 2: TÌM CTCT DỰA VÀO PỨ XÀ PHÒNG HOÁ( THỦY PHÂN TRONG MT KIỀM)

Phương pháp: + Đặt CTTQ của este đơn chức: R –COO-R’

+ Viết ptpứ thuỷ phân: R-COO-R + NaOH R-COONa + ROH

nmuèi MMuèi MR

+ Đặt nNaOH, hay neste (đã cho) vào ptr => => CTCT este

nancol MAncol MR,

Lưu ý: Thông thường khi đề cho m của chất nào ta định hướng tìm M của chất đó, rồi kết hợp với đề đáp án

+ CH3 ( 15), C2H5– (29), C2H3– (27), CH3COONa = 82, C2H5OH =46…

1: Thủy phân hoàn toàn 8,8g este đơn chức, mạch hở X với 100ml dung dịch NaOH 1M vừa đủ thu được 8,2 g muối hữu cơ Y và một ancol Z. Tên gọi của X là:

A. etyl fomat B. etyl propionat C. etyl axetat D. propyl axetat

2: Thủy phân hoàn toàn 8,8g este đơn chức, mạch hở X với 100ml dung dịch NaOH 1M vừa đủ, thu được muối hữu cơ Y và 4,6g ancol Z. Tên gọi của X là:

A. etyl fomat B. etyl propionate C. etyl axetat D. propyl axetat.

3: Cho 3,7 gam este no, đơn chức, mạch hở tác dạng hết với dd KOH, thu được muối và 2,3 gam ancol etylic. Công thức của este là:

A. CH3COOC2H5 B. C2H5COOCH3 C. C2H5COOC2H5 D. HCOOC2H5.

4 : Xà phòng hóa 8,8 gam etylaxetat bằng 150ml dd NaOH 1M. Sau khi p.ứ xảy ra hoàn toàn, cô cạn dd thu được chất rắn khan có khối lượng là:

A. 3,28 g B. 8,56 g C. 10,20 g D. 8,25 g

5: Xà phòng hóa 8,8 gam etylaxetat bằng 50ml dd NaOH 1M. Sau khi p.ứ xảy ra hoàn toàn, cô cạn dd thu được chất rắn khan có khối lượng là:

A. 4,1 g B. 8,5 g C. 10,2 g D. 8,2 g

6 : Một hỗn hợp X gồm etyl axetat và etyl fomat. Thủy phân 8,1 g hỗn hợp X cần 200ml dd NaOH 0,5M. Phần trăm về khối lượng của etylaxetat trong hỗn hợp là:

A. 75% B. 15% C. 54,32% D. 45,68%.

7 : Cho 10,4 g hỗn hợp X gồm axit axetit và etyl axetat tác dụng vừa đủ với 150g dung dịch NaOH 4%. Phần trăm khối lượng của etyl axetat trong hỗn hợp là: A. 22%. B. 42,3%. C. 57,7%. D. 88%.

8. X có CTPT C4H8O2. Cho 22g X tác dụng vừa đủ với NaOH được 17g muối. X là:

A. C2H5COOCH3 B. HCOOC3H7 C. CH3COOC2H5 D. C3H7COOH

9. Thủy phân hoàn toàn 4,4 gam este đơn chức A bằng 200ml dd NaOH 0,25M thu được 3,4 gam muối hữu cơ B. CTCT thu gọn của A là

A. HCOOCH3 B.CH3COOC2H5 C.HCOOC3H7 D.CH3COOC2H3

10. Thuỷ phân hoàn toàn 11,44 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,3M (vừa đủ) thu được 5,98 gam một ancol Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Etyl propionat D. Propyl axetat

11. Thuỷ phân hoàn toàn 8,88 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,2M (vừa đủ) thu được 8,16 gam một muối Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat

12 Thuỷ phân hoàn toàn 13,2 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,5M (vừa đủ) thu được 4,8 gam một ancol Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl propionat D. Propyl axetat

13. Thuỷ phân hoàn toàn một este no, đơn chức, mạch hở X với 200ml dung dịch NaOH 2M (vừa đủ) thu được 18,4 gam ancol Y và 32,8 gam một muối Z. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat

DẠNG 3: KẾT HỢP PHẢN ỨNG ĐỐT CHÁY VÀ THỦY PHÂN

Chú ý : Từ phản ứng đốt cháy ta suy ra được CTPT của este. Sau đó dựa vào phản ứng thủy phân sẽ suy ra được CTCT

Câu 1 : Đốt cháy hoàn toàn 1,48 g hợp chất hữu cơ X thu được 1,344 lít CO2 (đktc) và 1,08 g H2O. Nếu cho 1,48 g X tác dụng với NaOH thì thu được 1,36 g muối. CTCT của X là:

A. CH3COOCH3. B. HCOOC2H5. C. HCOOC3H7. D. C2H5COOH.

Câu 2: Đốt cháy hoàn toàn 1,1 g este X thu được 1,12 lít CO2 (đktc) và 0,9 g H2O. Nếu cho 4,4 g X tác dụng vừa đủ với 50 ml dd NaOH 1M thì tạo 4,1 g muối. CTCT của X là:

A. C2H5COOCH3. B. CH3COOC2H5. C. HCOOC3H7. D. C3H7COOH.

Câu 3: Đốt cháy hoàn toàn 7,4 g este X đơn chức thu được 6,72 lít khí CO2 (đktc) và 5,4 g nước. Nếu cho 7,4 g X tác dụng hoàn toàn với NaOH thì thu được 3,2 gam ancol Y và một lượng muối Z. Tìm CTCT của X, khối lượng muối Z

A. CH3COOCH3 – 6,8 gam B. CH3COOC2H5 – 6,8 gam

C. CH3COOCH3 – 8,2 gam D. CH3COOC2H5 – 8,2 gam

DẠNG 4: HIỆU SUẤT PHẢN ỨNG ESTE HÓA

Câu 1: Thực hiện phản ứng este hóa m (gam) axit axetic bằng một lượng dư ancol etylic (xt H2SO4 đặc), thu được 0,02 mol este (giả sử hiệu suất phản ứng đạt 100%) thì giá trị của m là:

A. 2,1g B. 1,2g C. 1,1g D. 1,4 g

Câu 2: Đun 12g axit axetic với một lượng dư ancol etylic (có H2SO4 đặc xt). Đến khi phản ứng kết thúc thu được 11g este. Hiệu suất phản ứng este hóa là:

A. 70% B. 75% C. 62,5% D. 50%

Câu 3 : Cho 6 g axit axetic tác dụng với 9,2 g ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau p.ứ thu được 4.4 g este. Hiệu suất của p.ứ este hóa là:

A. 75% B. 25% C. 50% D. 55%

Câu 4 : Cho 12 g axit axetic tác dụng với 6,9 g ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau p.ứ thu được 9,9 g este. Hiệu suất của p.ứ este hóa là:

A. 75% B. 25% C. 50% D. 55%

Câu 5 : Cho 6 g axit axetic tác dụng với 9,2 g ancol etylic (xúc tác H2SO4 đặc, đun nóng), với hiệu suất đạt 80%. Sau p.ứ thu được m gam este. Giá trị của m là

A. 2,16g B. 7,04g C. 14,08g D. 4,80 g

ESTE TRONG ĐỀ THI CÁC NĂM

A07: Một este có công thức phân tử là C4H6O2, khi thuỷ phân trong môi trường axit thu được axetanđehit. Công thức cấu tạo thu gọn của este đó là

A. HCOO-C(CH3)=CH2. B. HCOO-CH=CH-CH3.

C. CH3COO-CH=CH2. D. CH2=CH-COO-CH3.

B07: X là một este no đơn chức, có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là

A. HCOOCH(CH3)2. B. C2H5COOCH3.

C. CH3COOC2H5. D. HCOOCH2CH2CH3.

A11: Đốt cháy hoàn toàn 0,11 gam một este X (tạo nên từ một axit cacboxylic đơn chức và một ancol đơn chức) thu được 0,22 gam CO2 và 0,09 gam H2O. Số este đồng phân của X là

A. 2. B. 5. C. 4. D. 6.

A13: Chất nào sau đây khi đun nóng với dung dịch NaOH thu được sản phẩm có anđehit?

A. CH3-COO-C(CH3)=CH2. B. CH3-COO-CH=CH-CH3.

C. CH2=CH-COO-CH2-CH3. D. CH3-COO-CH2-CH=CH2.

MH2015: Số este có công thức phân tử C4H8O2 mà khi thủy phân trong môi trường axit thì thu được axit fomic là

A. 1. B. 2. C. 3. D. 4.

QG2015: Xà phòng hóa hoàn toàn 3,7 gam HCOOC2H5 bằng một lượng dung dịch NaOH vừa đủ. Cô cạn dung dịch sau phản ứng, thu được m gam muối khan. Giá trị của m là

A. 5,2. B. 3,4. C. 3,2. D. 4,8.

QG2015 28: Đun 3,0 gam CH3COOH với C2H5OH dư (xúc tác H2SO4 đặc), thu được 2,2 gam CH3COOC2H5. Hiệu suất của phản ứng este hóa tính theo axit là

A. 25,00%. B. 50,00%. C. 36,67%. D. 20,75%.

QG2016: Chất X có công thức cấu tạo CH3CH2COOCH3. Tên gọi của X là

A. propyl axetat. B. metyl propionat. C. metyl axetat. D. etyl axetat.

QG2016: Cho dãy các chất: CH≡C–CH=CH2; CH3COOH; CH2=CH–CH2–OH; CH3COOCH=CH2; CH2=CH2. Số chất trong dãy làm mất màu nước brom là

A. 2. B. 5. C. 4. D. 3.

MH2017: Số este có công thức phân tử C4H8O2

A. 6. B. 3. C. 4. D. 2.

MH2017: Thuỷ phân 4,4 gam etyl axetat bằng 100 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch, thu được m gam chất rắn khan. Giá trị của m là

A. 2,90. B. 4,28. C. 4,10. D. 1,64.

TN2017: Etyl axetat có công thức hóa học là

A. CH3COOCH3. B. CH3COOC2H5. C. HCOOCH3. D. HCOOC2H5.

TN2017: Thủy phân este X (C4H6O2) trong môi trường axit, thu được anđehit. Công thức của X là

A. CH3COOCH3. B. CH3COOCH=CH2.

C. CH2=CHCOOCH3. D. HCOOCH2CH=CH2.

TN2017: Hình vẽ sau đây mô tả thí nghiệm điều chế chất hữu cơ Y:

Phản ứng nào sau đây xảy ra trong thí nghiệm trên?

A. 2C6H12O6 + Cu(OH)2 (C6H11O6)2Cu + 2H2O

B. CH3COOH + C2H5OH CH3COOC2H5 + H2O

C. H2NCH2COOH + NaOH H2NCH2COONa + H2O

D. CH3COOH + NaOH CH3COONa + H2O

TN2017: Ba chất hữu cơ X, Y, Z có cùng công thức phân tử C4H8O2, có đặc điểm sau:

– X có mạch cacbon phân nhánh, tác dụng được với Na và NaOH.

– Y được điều chế trực tiếp từ axit và ancol có cùng số nguyên tử cacbon.

– Z tác dụng được với NaOH và tham gia phản ứng tráng bạc. Các chất X, Y, Z lần lượt là:

A. CH3CH2CH2COOH, CH3COOCH2CH3, HCOOCH2CH2CH3.

B. CH3CH(CH3)COOH, CH3CH2COOCH3, HCOOCH2CH2CH3.

C. CH3CH(CH3)COOH, CH3COOCH2CH3, HCOOCH2CH2CH3.

D. CH3CH2CH2COOH, CH3COOCH2CH3, CH3COOCH2CH3.

TK2017: Sản phẩm của phản ứng este hóa giữa ancol metylic và axit propionic là

A. propyl propionat. B. metyl propionat. C. propyl fomat. D. metyl axetat.

TK2017: Cho hỗn hợp gồm CH3COOC2H5 và CH3COONH4 tác dụng vừa đủ với 200 ml dung dịch NaOH 1M, thu được dung dịch chứa m gam muối. Giá trị của m là

A. 19,6. B. 9,8. C. 16,4. D. 8,2.

TK2017: Cho axit acrylic tác dụng với ancol đơn chức X, thu được este Y. Trong Y, oxi chiếm 32% về khối lượng. Công thức của Y là

A. C2H3COOCH3. B. CH3COOC2H5.

C. C2H5COOC2H3. D. C2H3COOC2H5.

TK2017: Xà phòng hóa hoàn toàn este X mạch hở trong dung dịch NaOH, thu được hỗn hợp các chất hữu cơ gồm: (COONa)2, CH3CHO và C2H5OH. Công thức phân tử của X là

A. C6H10O4. B. C6H10O2. C. C6H8O2. D. C6H8O4.

C. Rút kinh nghiệm

Ngày

Tổ trưởng kí duyệt

 

BẢN IN CHO HỌC SINH

ESTE (1)

Câu 1: Công thức tổng quát của este tạo bởi axit no đơn chức, mạch hở và ancol no, đơn chức. mạch hở có dạng: A. CnH2n-2O2 (n ≥ 3). B. CnH2nO2 (n ≥ 2). C. CnH2nO2 (n ≥ 3). D. CnH2n-2O2 (n ≥ 4).

Câu 2: Este có CTPT C3H6O2 có số đồng phân là: A. 4. B. 5. C. 3. D. 2.

Câu 3: Vinyl axetat là tên gọi của hợp chất nào sau đây ?

A. HCOOC2H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. CH3COOCH=CH2.

Câu 4: Phenyl axetat là tên gọi của hợp chất nào sau đây ?

A. CH3COOC6H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. CH3COOCH=CH2.

Câu 5: Metyl propionat là tên gọi của hợp chất nào sau đây ?

A. HCOOC2H5 B. CH2=CH-COOCH3 C. C2H5COOCH3 D. HCOOCH=CH2.

Câu 6: Hợp chất X có CTPT C4H8O2. Khi thủy phân X trong dd NaOH thu được muối C2H3O2Na. CTCT của X là:

A. HCOOC3H7. B. C2H5COOCH3. C. CH3COOC2H5. D. C3H7COOH.

Câu 7: Hợp chất X có CTPT C4H8O2. Khi thủy phân X trong dd NaOH thu được muối CHO2Na. CTCT của X là: A. HCOOC3H7. B. C2H5COOCH3. C. CH3COOC2H5. D. C3H7COOH.

Câu 8: Thuỷ phân hỗn hợp metyl axetat và etyl axetat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol. C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 9: Khi nói về este vinyl axetat, mệnh đề nào sau đây không đúng?

A. Xà phòng hóa cho ra 1 muối và 1 anđehit. B. Không thể điều chế trực tiếp từ axit hữu cơ và ancol.

C. Vinyl axetat là một este không no, đơn chức. D. Thuỷ phân este trên thu được axit axetic và axetilen.

Câu 10: Este C4H8O2 có gốc ancol là metyl thì axit tạo nên este đó là:

A. axit oxalic. B. axit butiric. C. axit propionic. D. axit axetic.

Câu 11: Este C4H8O2 có gốc ancol là etyl thì axit tạo nên este đó là:

A. axit oxalic. B. axit butiric. C. axit propionic. D. axit axetic.

*Câu 12: Cặp chất nào sau đây dùng để điều chế vinylaxetat bằng một phản ứng trực tiếp?

A. CH3COOH và C2H3OH. B. C2H3COOH và CH3OH.

C. CH3COOH và C2H2. D. CH3COOH và C2H5OH.

*Câu 13: Cho este CH3COOC6H5 tác dụng với dd KOH dư. Sau phản ứng thu được muối hữu cơ gồm:

A. CH3COOK và C6H5OH. B. CH3COOK và C6H5OK.

C. CH3COOH và C6H5OH. D. CH3COOH và C6H5OK.

Câu 14: Tên gọi của este có mạch cacbon thẳng, có thể tham gia phản ứng tráng bạc, có CTPT C4H8O2

A. propyl fomat. B. isopropyl fomat. C. etyl axetat. D. metyl propionat.

Câu 15: Phát biểu nào sau đây đúng ?

A. este nhẹ hơn nước và tan nhiều trong nước.

B. este no, đơn chức, mạch hở có công thức CnH2nO2 (n ≥ 2).

C. phản ứng thủy phân este trong môi trường kiềm là phản ứng thuận nghịch.

D. đốt cháy este no, đơn chức, mạch hở thu được nCO2>nH2O.

Câu 16: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là

A. HCOOH < CH3COOH < C2H5OH. B. CH3COOCH3 < C2H5OH < CH3COOH.

C. CH3OH < CH3COOH < C2H5OH. D. HCOOH < CH3OH < CH3COOH

Câu 17: Nhiệt độ sôi của các chất được sắp xếp theo thứ tự tăng dần đúng là

A. HCOOH < CH3COOH < C2H5OH < CH3CHO.

B. C2H6 < HCOOCH3 < C2H5OH < CH3COOH.

C. CH3CHO < CH3OH < CH3COOH < C2H5OH.

D. CH3CHO < HCOOH < CH3OH < CH3COOH.

Câu 18: Phản ứng thủy phân este trong môi trường kiềm được gọi là phản ứng:

A. Xà phòng hóa B. Hidrat hóa C. Crackinh D. Sự lên men

*Câu 19: Cho các chất: C6H5OH, HCHO, CH3CH2OH, C2H5OC2H5, CH3COCH3, HCOOCH3, CH3COOCH3, CH3COOH, HCOOH, HCOONa tác dụng với dd AgNO3/NH3, đun nóng. Số phản ứng xảy ra là:

A. 2. B.3. C. 4. D. 5.

*Câu 20: Cho các chất lỏng nguyên chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH lần lượt tác dụng với Na. Số phản ứng xảy ra là:

A. 2. B. 3. C. 4. D. 5.

*Câu 21: Cho lần lượt các chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH tác dụng với dd NaOH, đun nóng. Số phản ứng xảy ra là:

A. 2. B. 3. C. 4. D. 5.

DẠNG 1: TÌM CTPT CỦA ESTE NO, ĐƠN CHỨC (CnH2nO2) DỰA VÀO PỨ ĐỐT CHÁY

Câu 1: Đốt cháy hoàn toàn 0,15 mol este thu được 19,8g CO2 và 0,45 mol H­2O. Công thức phân tử este là

A. C2H4O2 B. C3H6O2 C. C4H8O2 D. C5H10O2

Câu 2: Đốt cháy hoàn toàn 3,7g một este đơn chức X thu được 3,36 lit khí CO2 (đktc) và 2,7g nước. CTPT của X là:

A. C2HO2 B. C3H6O2 C. C4H8O2 D. C5H8O2

Câu 3: Đốt cháy hoàn toàn một este no, đơn chức rồi dẫn sản phẩm cháy qua bình đựng KOH dư, thấy khối lượng bình tăng 9,3 gam. Số mol CO2 và H2O sinh ra lần lượt là:

A. 0,1 và 0,1. B. 0,15 và 0,15. C. 0,25 và 0,05. D. 0,05 và 0,25.

Câu 4: Đốt cháy hoàn 4,4 gam một este no, đơn chức, mạch hở A, rồi dẫn sản phẩm cháy qua bình đựng nước vôi trong dư thu được 20 gam kết tủa. Công thức phân tử của A là:

A. C2H4O2. B. C3H6O2. C. C5H10O2. D. C4H8O2.

Câu 5: Đốt cháy hoàn 4,08 gam một este no, đơn chức mạch hở A, rồi dẫn sản phẩm cháy qua bình đựng nước vôi trong thu được 10 gam kết tủa và ddX. Đung kỹ ddX thu được 5 gam kết tủa nữa. Công thức phân tử của A là: A. C5H10O2. B. C3H6O2. C. C3H4O2. D. C4H6O2.

DẠNG 2: TÌM CTCT DỰA VÀO PỨ XÀ PHÒNG HOÁ( THỦY PHÂN TRONG MT KIỀM)

1: Thủy phân hoàn toàn 8,8g este đơn chức, mạch hở X với 100ml dung dịch NaOH 1M vừa đủ thu được 8,2 g muối hữu cơ Y và một ancol Z. Tên gọi của X là:

A. etyl fomat B. etyl propionat C. etyl axetat D. propyl axetat

2: Thủy phân hoàn toàn 8,8g este đơn chức, mạch hở X với 100ml dung dịch NaOH 1M vừa đủ, thu được muối hữu cơ Y và 4,6g ancol Z. Tên gọi của X là:

A. etyl fomat B. etyl propionate C. etyl axetat D. propyl axetat.

3: Cho 3,7 gam este no, đơn chức, mạch hở tác dạng hết với dd KOH, thu được muối và 2,3 gam ancol etyliC. Công thức của este là:

A. CH3COOC2H5 B. C2H5COOCH3 C. C2H5COOC2H5 D. HCOOC2H5.

4 : Xà phòng hóa 8,8 gam etylaxetat bằng 150ml dd NaOH 1M. Sau khi p.ứ xảy ra hoàn toàn, cô cạn dd thu được chất rắn khan có khối lượng là:

A. 3,28 g B. 8,56 g C. 10,20 g D. 8,25 g

5: Xà phòng hóa 8,8 gam etylaxetat bằng 50ml dd NaOH 1M. Sau khi p.ứ xảy ra hoàn toàn, cô cạn dd thu được chất rắn khan có khối lượng là:

A. 4,1 g B. 8,5 g C. 10,2 g D. 8,2 g

6 : Một hỗn hợp X gồm etyl axetat và etyl fomat. Thủy phân 8,1 g hỗn hợp X cần 200ml dd NaOH 0,5M. Phần trăm về khối lượng của etylaxetat trong hỗn hợp là:

A. 75% B. 15% C. 54,32% D. 45,68%.

7 : Cho 10,4 g hỗn hợp X gồm axit axetit và etyl axetat tác dụng vừa đủ với 150g dung dịch NaOH 4%. Phần trăm khối lượng của etyl axetat trong hỗn hợp là:

A. 22%. B. 42,3%. C. 57,7%. D. 88%.

8. X có CTPT C4H8O2. Cho 22g X tác dụng vừa đủ với NaOH được 17g muối. X là:

A. C2H5COOCH3 B. HCOOC3H7 C. CH3COOC2H5 D. C3H7COOH

9. Thủy phân hoàn toàn 4,4 gam este đơn chức A bằng 200ml dd NaOH 0,25M thu được 3,4 gam muối hữu cơ B. CTCT thu gọn của A là

A. HCOOCH3 B.CH3COOC2H5 C.HCOOC3H7 D.CH3COOC2H3

10. Thuỷ phân hoàn toàn 11,44 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,3M (vừa đủ) thu được 5,98 gam một ancol Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Etyl propionat D. Propyl axetat

11. Thuỷ phân hoàn toàn 8,88 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,2M (vừa đủ) thu được 8,16 gam một muối Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat

12 Thuỷ phân hoàn toàn 13,2 gam este no, đơn chức, mạch hở X với 100ml dung dịch NaOH 1,5M (vừa đủ) thu được 4,8 gam một ancol Y. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl propionat D. Propyl axetat

13. Thuỷ phân hoàn toàn một este no, đơn chức, mạch hở X với 200ml dung dịch NaOH 2M (vừa đủ) thu được 18,4 gam ancol Y và 32,8 gam một muối Z. Tên gọi của X là

A. Etyl fomat B. Etyl axetat C. Metyl axetat D. Propyl axetat

ESTE (2)

Bài 2: Viết pthh của pư xảy ra khi cho các chất sau tác dụng với dd KOH (đun nóng)

1. HCOOCH2CH2OOCCH3. 2. CH3COOCH2CH2OOCCH3.

3. HCOOCH2CH2CH2OOCH. 4. HCOOCH2CH(CH3)OOCH.

5. CH3COO–(CH2)2–COOC2H5. 6. CH3OOC–(CH2)2–COOC2H5.

7. CH3OOC–CH2–COO–C2H5. 8. CH3COO–(CH2)2–OOCC2H5.

9. CH3COOC(CH3)=CH2. 10. HCOOCH=CHCH2CH3.

11. HCOOCH2CH=CHCH3. 12. HCOOC(CH3)=CHCH3.

13. CH3OCO-CH2-COOC2H5. 14. C2H5OCO-COOCH3.

15. CH3OCO-COOC3H7. 16. CH3OCO-CH2-CH2-COOC2H5.

17. HCOOCH2COOC2H5 18. CH3COOCH2CH2COOC6H5

19. CH3COOCH2OCOCH3 20. CH3COOCH(CH3)OCOC2H5

21. C6H5OCO-COOC6H5 22. C6H5COOCH=CHCH2OCOCH3

23. 24. 25.

Câu 22: Phát biểu nào sau không đây đúng?

A. este nhẹ hơn nước và không tan trong nước.

B. este no, đơn chức, mạch hở có công thức CnH2nO2 (n ≥ 2).

C. phản ứng thủy phân este trong môi trường kiềm là phản ứng xà phòng hóa.

D. đốt cháy este no, đơn chức, mạch hở thu được nCO2>nH2O.

Câu 23: Thuỷ phân hỗn hợp metyl axetat và etyl fomat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol.

C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 24: Este nào sau đây thủy phân trong môi trường axit cho hỗn hợp 2 chất hữu cơ đều tham gia p.ứ tráng bạc ?

A. CH3COOC2H5. B. HCOOCH=CH2. C. HCOOC3H7. D. CH3COOC6H5.

*Câu 25: Chất nào sau đây không tạo este với axit axetic?

A. C2H5OH B. C3H5(OH)3. C. C2H2 D. C6H5OH

Câu 26: Thuỷ phân hỗn hợp metyl axetat và metyl fomat trong dd NaOH đun nóng, sau phản ứng ta thu được

A. 1 muối và 1 ancol. B. 1 muối và 2 ancol. C. 2 muối và 1 ancol. D. 2 muối và 2 ancol.

*Câu 27: Thủy phân vinylaxetat bằng dd KOH vừa đủ. Sản phẩm thu được là

A. CH3COOK, CH2=CH-OH. B. CH3COOK, CH3CHO.

C. CH3COOH, CH3CHO. D. CH3COOK, CH3CH2OH.

Câu 28: Đốt cháy một este hữu cơ X thu được 13,2g CO2 và 5,4g H2O. X thuộc loại este

A. no, đơn chức, mạch hở. B. mạch vòng, đơn chức .

C. hai chức, no, mạch hở. D. có 1 liên kết đôi, chưa xác định nhóm chức.

Câu 29: Este nào sau đây thủy phân trong môi trường axit cho 2 chất hữu cơ đều không tham gia phản ứng tráng bạc ?

A. HCOOC6H5. B. CH3COOCH=CH2. C. CH3COOC2H5. D. HCOOCH=CH2.

*Câu 30: Este CH3COOCH=CH2 tác dụng được với chất nào sau đây ?

A. H2/Ni,t0. B. Br2. C. NaOH. D. Tất cả đều đúng.

Câu 31: Đặc điểm của phản ứng thủy phân este no, đơn chức, mạch hở trong môi trường axit là:

A. thuận nghịch. B. một chiều.

C. luôn sinh ra muối và ancol D. xảy ra nhanh ở nhiệt độ thường.

Câu 32: Cho các chất sau: CH3COOCH3 (1), CH3COOH (2), HCOOC2H5 (3), CH3CHO (4). Chất nào khi tác dụng với NaOH cho cùng một loại muối là CH3COONa ?

A. (1), (4). B. (2), (4). C. (1), (2). D. (1), (3).

Câu 33: Chất nào sau đây có nhiệt độ sôi thấp nhất ?

A. C4H9OH. B. C3H7COOH. C. CH3COOC2H5. D. C6H5OH.

*Câu 34: Cho các chất lỏng nguyên chất: HCl, C6H5OH, CH3CH2Cl, CH3CH2OH, CH3COOCH3, CH3COOH lần lượt tác dụng với Na. Số chất tác dụng với NaOH nhưng không tác dụng với Na là:

A. 2. B. 3. C. 4. D. 5.

Câu 35: Este X có CTPT là C3H6O2 , có khả năng tham gia phản ứng tráng bạc. Công thức cấu tạo của X là:

A. CH3COOCH3. B. CH3COOC2H5. C. C2H5COOH. D. HCOOC2H5.

*Câu 36: Phát biểu nào sau đây không đúng ?

A. CH3COO-CH=CH2 có thể trùng hợp tạo polime.

B. CH3COO-CH=CH2 tác dụng được với dd Br2 hoặc cộng H2/Ni,t0.

C. CH3COO-CH=CH2 tác dụng với NaOH thu được muối và anđehit.

D. CH3COO-CH=CH2 cùng dãy đồng đẳng với CH2=CH-COOCH3.

Câu 37: Đốt cháy hoàn toàn este no, đơn chức, mạch hở X, thể tích CO2 sinh ra bằng thể tích O2 phản ứng (ở cùng điều kiện). Este X là:

A. metyl axetat B. metyl fomat. C. etyl axetat. D. metyl propionat.

Câu 38: Este có CTPT C4H8O2 có số đồng phân là:

A. 4. B. 5. C. 3. D. 2.

Câu 39: Este X có CTPT là C4H8O2 tạo bởi axit propionic và ancol Y. Ancol Y là:

A. ancol metylic. B. ancol etylic. C. ancol propylic. D. ancol butylic.

Câu 40: Phản ứng tương tác giữa axit cacboxylic với ancol được gọi là:

A. phản ứng trung hòa. B. phản ứng hidro hóa.

C. phản ứng este hóa. D. phản ứng xà phòng hóa.

Câu 41: Phát biểu nào sau đây không đúng?

A. Phản ứng este hóa luôn xảy ra hoàn toàn.

B. Khi thủy phân este no, đơn chức mạch hở trong môi trường axit sẽ cho axit và ancol.

C. Phản ứng giữa axit và ancol là phản ứng thuận nghịch.

D. Khi thủy phân este no, đơn chức, mạch hở trong môi trường kiềm sẽ cho muối và ancol.

Câu 42: Mệnh đề nào sau đây không đúng?

A. Metyl fomat có CTPT là C2H4O2. B. Metyl fomat là este của axit etanoic.

C. Metyl fomat có thể tham gia phản ứng tráng bạc.

D. Thuỷ phân metyl fomat trong môi trường axit tạo thành ancol metylic và axit fomic.

*Câu 43: Metyl acrylat có công thức cấu tạo thu gọn là

A. C2H5COOCH3. B. CH3COOC2H5. C. CH2=CHCOOCH3. D. CH3COOCH3.

Câu 44: Phát biểu nào sau đây không đúng ?

A. Hợp chất CH3COOC2H5 thuộc loại este.

B. este no, đơn chức, mạch hở có công thức phân tử là CnH2nO2 (n ≥ 2).

C. Este là h.chất hữu cơ trong p.tử có nhóm COO.

D. Sản phẩm hữu cơ của p.ư giữa axit cacboxylic và ancol là este.

DẠNG 3: KẾT HỢP PHẢN ỨNG ĐỐT CHÁY VÀ THỦY PHÂN

Câu 1 : Đốt cháy hoàn toàn 1,48 g hợp chất hữu cơ X thu được 1,344 lít CO2 (đktc) và 1,08 g H2O. Nếu cho 1,48 g X tác dụng với NaOH thì thu được 1,36 g muối. CTCT của X là:

A. CH3COOCH3. B. HCOOC2H5. C. HCOOC3H7. D. C2H5COOH.

Câu 2: Đốt cháy hoàn toàn 1,1 g este X thu được 1,12 lít CO2 (đktc) và 0,9 g H2O. Nếu cho 4,4 g X tác dụng vừa đủ với 50 ml dd NaOH 1M thì tạo 4,1 g muối. CTCT của X là:

A. C2H5COOCH3. B. CH3COOC2H5. C. HCOOC3H7. D. C3H7COOH.

Câu 3: Đốt cháy hoàn toàn 7,4 g este X đơn chức thu được 6,72 lít khí CO2 (đktc) và 5,4 g nước. Nếu cho 7,4 g X tác dụng hoàn toàn với NaOH thì thu được 3,2 gam ancol Y và một lượng muối Z. Tìm CTCT của X, khối lượng muối Z

A. CH3COOCH3 – 6,8 gam B. CH3COOC2H5 – 6,8 gam

C. CH3COOCH3 – 8,2 gam D. CH3COOC2H5 – 8,2 gam

DẠNG 4: HIỆU SUẤT PHẢN ỨNG ESTE HÓA

Câu 1: Thực hiện phản ứng este hóa m (gam) axit axetic bằng một lượng dư ancol etylic (xt H2SO4 đặc), thu được 0,02 mol este (giả sử hiệu suất phản ứng đạt 80%) thì giá trị của m là:

A. 1,6g B. 1,5g C. 1,2g D. 1,4 g

Câu 2: Đun 12g axit axetic với một lượng dư ancol etylic (có H2SO4 đặc xt). Đến khi phản ứng kết thúc thu được 11g este. Hiệu suất phản ứng este hóa là:

A. 70% B. 75% C. 62,5% D. 50%

Câu 3: Cho 6 g axit axetic tác dụng với 9,2 g ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau p.ứ thu được 4.4 g este. Hiệu suất của p.ứ este hóa là:

A. 75% B. 25% C. 50% D. 55%

Câu 4: Cho 12 g axit axetic tác dụng với 6,9 g ancol etylic (xúc tác H2SO4 đặc, đun nóng). Sau p.ứ thu được 9,9 g este. Hiệu suất của p.ứ este hóa là:

A. 75% B. 25% C. 50% D. 55%

Câu 5: Cho 6 g axit axetic tác dụng với 9,2 g ancol etylic (xúc tác H2SO4 đặc, đun nóng), với hiệu suất đạt 80%. Sau p.ứ thu được m gam este. Giá trị của m là

A. 2,16g B. 7,04g C. 14,08g D. 4,80 g

ESTE (3)

A07: Một este công thức phân tử C4H6O2, khi thuỷ phân trong môi trưng axit thu đưc axetanđehit. Công thức cấu tạo thu gọn của este đó là

A. HCOO-C(CH3)=CH2. B. HCOO-CH=CH-CH3.

C. CH3COO-CH=CH2. D. CH2=CH-COO-CH3.

B07: X là một este no đơn chức, có tỉ khối hơi đối với CH4 là 5,5. Nếu đem đun 2,2 gam este X với dung dịch NaOH (dư), thu được 2,05 gam muối. Công thức cấu tạo thu gọn của X là

A. HCOOCH(CH3)2. B. C2H5COOCH3.

C. CH3COOC2H5. D. HCOOCH2CH2CH3.

A11: Đt cháy hoàn toàn 0,11 gam một este X (tạo nên t một axit cacboxylic đơn chức một ancol đơn chức) thu đưc 0,22 gam CO2 và 0,09 gam H2O. Số este đồng phân của X là

A. 2. B. 5. C. 4. D. 6.

A13: Chất nào sau đây khi đun nóng với dung dịch NaOH thu được sản phẩm có anđehit?

A. CH3-COO-C(CH3)=CH2. B. CH3-COO-CH=CH-CH3.

C. CH2=CH-COO-CH2-CH3. D. CH3-COO-CH2-CH=CH2.

MH2015: Số este có công thức phân tử C4H8O2 mà khi thủy phân trong môi trường axit thì thu được axit fomic là

A. 1. B. 2. C. 3. D. 4.

QG2015 18: Xà phòng hóa hoàn toàn 3,7 gam HCOOC2H5 bằng một lượng dung dịch NaOH vừa đủ. Cô cạn dung dịch sau phản ứng, thu được m gam muối khan. Giá trị của m là

A. 5,2. B. 3,4. C. 3,2. D. 4,8.

QG2015 28: Đun 3,0 gam CH3COOH với C2H5OH dư (xúc tác H2SO4 đặc), thu được 2,2 gam CH3COOC2H5. Hiệu suất của phản ứng este hóa tính theo axit là

A. 25,00%. B. 50,00%. C. 36,67%. D. 20,75%.

QG2016: Chất X có công thức cấu tạo CH3CH2COOCH3. Tên gọi của X là

A. propyl axetat. B. metyl propionat. C. metyl axetat. D. etyl axetat.

QG2016: Cho dãy các chất: CH≡C–CH=CH2; CH3COOH; CH2=CH–CH2–OH; CH3COOCH=CH2; CH2=CH2. Số chất trong dãy làm mất màu nước brom là

A. 2. B. 5. C. 4. D. 3.

MH2017: Số este có công thức phân tử C4H8O2

A. 6. B. 3. C. 4. D. 2.

MH2017: Thuỷ phân 4,4 gam etyl axetat bằng 100 ml dung dịch NaOH 0,2M. Sau khi phản ứng xảy ra hoàn toàn, cô cạn dung dịch, thu được m gam chất rắn khan. Giá trị của m là

A. 2,90. B. 4,28. C. 4,10. D. 1,64.

TN2017: Etyl axetat có công thức hóa học là

A. CH3COOCH3. B. CH3COOC2H5. C. HCOOCH3. D. HCOOC2H5.

TN2017: Thủy phân este X (C4H6O2) trong môi trường axit, thu được anđehit. Công thức của X là

A. CH3COOCH3. B. CH3COOCH=CH2.

C. CH2=CHCOOCH3. D. HCOOCH2CH=CH2.

TN2017: Hình vẽ sau đây mô tả thí nghiệm điều chế chất hữu cơ Y:

Phản ứng nào sau đây xảy ra trong thí nghiệm trên?

A. 2C6H12O6 + Cu(OH)2 (C6H11O6)2Cu + 2H2O

B. CH3COOH + C2H5OH CH3COOC2H5 + H2O

C. H2NCH2COOH + NaOH H2NCH2COONa + H2O

D. CH3COOH + NaOH CH3COONa + H2O

TN2017: Ba chất hữu cơ X, Y, Z có cùng công thức phân tử C4H8O2, có đặc điểm sau:

– X có mạch cacbon phân nhánh, tác dụng được với Na và NaOH.

– Y được điều chế trực tiếp từ axit và ancol có cùng số nguyên tử cacbon.

– Z tác dụng được với NaOH và tham gia phản ứng tráng bạc. Các chất X, Y, Z lần lượt là:

A. CH3CH2CH2COOH, CH3COOCH2CH3, HCOOCH2CH2CH3.

B. CH3CH(CH3)COOH, CH3CH2COOCH3, HCOOCH2CH2CH3.

C. CH3CH(CH3)COOH, CH3COOCH2CH3, HCOOCH2CH2CH3.

D. CH3CH2CH2COOH, CH3COOCH2CH3, CH3COOCH2CH3.

TK2017: Sản phẩm của phản ứng este hóa giữa ancol metylic và axit propionic là

A. propyl propionat. B. metyl propionat. C. propyl fomat. D. metyl axetat.

TK2017: Cho hỗn hợp gồm CH3COOC2H5 và CH3COONH4 tác dụng vừa đủ với 200 ml dung dịch NaOH 1M, thu được dung dịch chứa m gam muối. Giá trị của m là

A. 19,6. B. 9,8. C. 16,4. D. 8,2.

TK2017: Cho axit acrylic tác dụng với ancol đơn chức X, thu được este Y. Trong Y, oxi chiếm 32% về khối lượng. Công thức của Y là

A. C2H3COOCH3. B. CH3COOC2H5. C. C2H5COOC2H3. D. C2H3COOC2H5.

TK2017: Xà phòng hóa hoàn toàn este X mạch hở trong dung dịch NaOH, thu được hỗn hợp các chất hữu cơ gồm: (COONa)2, CH3CHO và C2H5OH. Công thức phân tử của X là

A. C6H10O4. B. C6H10O2. C. C6H8O2. D. C6H8O4.

Bài tập tự luận

VDTT1: Thủy phân hoàn toàn 0,11 mol một este đơn chức trong 150ml dung dịch NaOH 1M đun nóng. Sau phản ứng người ta cô cạn dung dịch thì thu được 9,08 gam chất rắn khan và 5,06 gam ancol. Tên gọi của este là? (ĐS: etyl fomat)

VDTT1’: Xà phòng hóa hoàn toàn hỗn hợp hai este đơn chức X, Y cần 250 ml dung dịch NaOH 1M. Sau phản ứng, cô cạn dung dịch thu được 22,6 gam hỗn hợp hai muối của hai axit là đồng đẳng kế tiếp và 11,5 gam một ancol. Công thức cấu tạo thu gọn của hai este là? (ĐS: CH3COOC2H5 và C2H5COOC2H5)

VD5: Một este có tỷ khối so với H2 là 68. Cho10,2 gam este này tác dụng vừa đủ với 150 ml dung dịch KOH 1M thu được hai muối trong đó một muối có khối lượng 6,3 gam. Số đồng phân của este này là? (ĐS: HCOOC6H4CH3 – 3 đồng phân cấu tạo)

VDTT1: Thủy phân hoàn toàn 0,15 mol một este cần 300 ml dung dịch NaOH 1M thu được 20,4 gam một muối khi cô cạn và 9,3 gam hơi ancol. Ancol này có khả năng hòa tan được Cu(OH)2 ở nhiệt độ thường. Xác định công thức của este? (ĐS: (HCOO)2C2H4)

VDTT2: Thủy phân hoàn toàn 0,1 mol một este hai chức bằng 300 ml dung dịch NaOH 1M. Sau phản ứng cô cạn dung dịch thu được 19 gam chất rắn khan (trong đó có chứa hai muối của hai axit là đồng đẳng kế tiếp) và 6,2 gam ancol đa chức. Xác định công thức của este? (ĐS: CH3COOC2H4OOCH)

VDTT3: Thủy phân hoàn toàn 0,25 mol một este cần 100 ml dung dịch NaOH 5M. Sau phản ứng cô cạn dung dịch thu được 41 gam hỗn hợp hai muối khan của hai axit đơn chức và 15,5 gam một ancol. Xác định công thức của este? (ĐS: HCOOC2H4OOCC2H5)

VDTT4: Thủy phân hoàn toàn 0,05 mol một este cần 150 ml dung dịch NaOH 1M. Sau phản ứng cô cạn dung dịch thu được 11,6 gam hỗn hợp hai muối khan của hai axit đơn chức và 4,6 gam một ancol. Xác định công thức của este? (ĐS: C3H5(OCOC2H5)(OCOH)2 hoặc…)

VDTT9: Thủy phân hoàn toàn 0,4 mol một este cần 0,8 mol NaOH thu được 53,6 gam một muối và 31,2 gam hai ancol đồng đẳng kế tiếp. Xác định công thức của este? ĐS: (H3COOC-COOC2H5)

VDTT10: Thủy phân hoàn toàn 0,3 mol một este cần 0,6 mol NaOH thu được 44,4 gam một muối và 31,8 gam hai ancol đồng đẳng kế tiếp. Xác định công thức của este? ĐS: (H5C2OOC-CH2-COOC3H7)

VDTT11: Thủy phân hoàn toàn 0,1 mol một este cần 100 ml dung dịch NaOH 2M. Sau phản ứng cô cạn dung dịch thu được 13,4 gam muối khan và 9,2 gam hỗn hợp hai ancol đơn chức. Xác định công thức của este? ĐS: (H3COOC-COOC3H7)

VDTT12: Thủy phân hoàn toàn 0,1 mol một este cần 150 ml dung dịch NaOH 2M. Sau phản ứng cô cạn dung dịch thu được 21,4 gam một muối khan và 12,4 gam hỗn hợp hai ancol đơn chức. Xác định công thức của este? ĐS: (C9H14O6)

VD9: Thủy phân hoàn toàn 0,1 mol este E (mạch hở và chỉ chứa một loại nhóm chức) cần dùng vừa đủ 100 ml dung dịch NaOH 3M, thu được 24,6 gam muối của một axit hữu cơ và 9,2 gam một ancol. Xác định công thức của este? ĐS: ((CH3COO)3C3H5)

ESTE (4)

Bài 1: Cho biết tên hoặc công thức và viết pthh của p.ứng thủy phân các este sau trong môi trường kiềm (NaOH):
1. Metyl axetat 2. CH3COOCH=CH2 3. Etyl acylat

4. C6H5COOCH2CH3 5. Isopropyl fomat 6. CH3CH2COOC6H5

7. Anlyl benzoat 8. CH2=CHCOOC2H5 9. Vinyl propionat

10. HCOOCH3 11. Phenyl axetat 12. HCOOCH(CH3)2

13. Benzyl fomat 14. CH3COOCH2C6H5

Bài 3: Hoàn thành các phương trình phản ứng sau:

1. Este + NaOH CH3COONa + CH3CHO 2. Este + NaOH CH2(COONa)2 + CH3OH + C2H5OH

3. Este + NaOH CH3COONa + C2H5COONa + C2H4(OH)2

4. Este + NaOH HOCH2CH(CH3)CH(CH3)CH2COONa

5. Este + NaOH (COONa)2 + CH3CHO + C2H5OH 6. Este + NaOH C6H5COONa + CH3CH2COCH3

7. Este + NaOH HCOONa + CH2C6H4ONa + H2O 8. Este + NaOH CH3COONa + HCHO + H2O

9. Este + NaOH HCOONa + C6H4(ONa)2 + H2O

10. Este + NaOH CH3COONa + HCOONa + HOCH2C6H4ONa + H2O

Bài 3: Hoàn thành các phản ứng theo sơ đồ sau (dưới dạng công thức cấu tạo).

1. C3H4O2 + NaOH (A) + (B) 2. (A) + H2SO4 (loãng) (C) + (D)

3. (C) + AgNO3 + NH3 + H2O (E) + Ag + NH4NO3

4. (B) + AgNO3 + NH3 + H2O (F) + Ag + NH4NO3

HD: C3H4O2 có CTCT HCOOCH=CH2, A là HCOONa, B: CH3CHO, C: HCOOH, D: Na2SO4,

E: HO-COONH4, F: CH3COONH4

Bài 4: Hoàn thành các sơ đồ phản ứng sau:

HD: X: CH3COOCH=CH2, A: CH3CHO, B: CH3COONa, C: CH3COOH, D: C2H2, E: C2H4, G: C4H6

Câu 1: Este X (C4H8O2) thoả mãn các điều kiện: X Y1 + Y2 và Y1 Y2. X có tên là

A. isopropyl fomat B. Propyl fomat C. metyl propionat D. etyl axetat

Câu 2: Thuỷ phân este C2H5COOCH=CH2 trong môi trường axit tạo sản phẩm

A. C2H5COOH, CH2=CH-OH B. C2H5COOH, HCHO

C. C2H5COOH, CH3CHO D. C2H5COOH, CH3CH2OH

Câu 3: Thủy phân este A trong môi trường axit thu được hỗn hợp 2 chất đều tham gia phản ứng tráng bạc. Công thức cấu tạo của A là

A. CH3COOCH=CH2 B. HCOOCH2CH=CH2 C. HCOOC(CH3)=CH2 D. HCOOCH=CH-CH3

Câu 4: Có bao nhiêu este mạch hở có công thức phân tử C5H8O2 khi xà phòng hoá tạo ra anđehit (không kể đồng phân hình học)

A. 1 B. 2 C. 3 D. 4

Câu 5: Thuỷ phân hoàn toàn một este đơn chức có tỉ khối hơi so với không khí bằng 4 bằng dung dịch NaOH thì thu được muối có khối lượng phân tử bằng 24/29 khối lượng phân tử este. Công thức của este là

A. C4H9COOCH3 B. C3H7COOC2H5 C. C2H5COOC2H5 D. C2H5COOC3H7

Câu 6: Đun nóng 8,8 gam este B có công thức C4H8O2 với 200 ml dung dịch NaOH 1M. Cô cạn dung dịch sau phản ứng thu được 12,2 gam chất rắn. Tên gọi của B là

A. propyl fomat B. etyl axetat C. metyl propionat D. metyl axetat

Câu 7: X là một este no đơn chức, có tỉ khối hơi so với CH4 là 5,5. Nếu đem đun 2,2 gam este X với NaOH dư, thu được 2,05 gam muối. Công thức ancol tạo nên X là

A. C2H5COOCH3 B. CH3COOH C. C2H5OH D. CH3COOC2H5

Câu 8: Este đơn chức X có tỉ khối hơi so với CH4 là 6,25.Cho 20 gam X tác dụng với 300 ml dung dịch KOH 1M. Cô cạn dung dịch được sau phản ứng thu được 28 gam chất rắn khan. Công thức cấu tạo của X

A. CH2=CH-CH2COOCH3 B. CH2=CH-COOCH2CH3

C. CH3COOCH=CH-CH3 D. CH3-CH2COOCH=CH2

Câu 9: Để thuỷ phân hoàn toàn 4,64 gam một este đơn chức X thì cần 40ml dung dịch NaOH 1M. Sau phản ứng, thu được muối Y và ancol Z. Đốt cháy hoàn toàn 0,5 mol Z thì thu được 22,4 lít CO2 (đktc). Công thức đúng của X là A. HCOOC5H11 B. C3H7COOC2H5 C. C2H5COOC3H7 D. C2H5COOC2H5

Câu 10 : Một este đơn chức, mạch hở có khối lượng là 12,9 gam tác dụng vừa đủ với 150 ml dung dịch KOH 1M. Sau phản ứng thu được một muối và một anđehit. Công thức của este là

A. HCOOCH=CH−CH3 B. CH3COOCH=CH2

C. C2H5COOCH=CH2 D. HCOOCH=CH−CH3 và CH3COOCH=CH2

Câu 11: Chất nào dưới đây không phải là este?

A. HCOOCH3 B. CH3COOH C. CH3COOCH3 D. HCOOC6H5

Câu 12: Cho các chất có công thức cấu tạo sau đây: (1) CH3CH2COOCH3, (2) CH3OOCCH3, (3) HCOOC2H5, (4) CH3COOH, (5) CH3CH(COOCH3)(COOC2H5), (6) HOOCCH2CH2OH, (7) CH3OOC−COOC2H5. Những chất thuộc loại este là:

A. (1), (2), (3), (4), (5), (6) B. (1), (2), (3), (5), (7)

C. (1), (2), (4), (6), (7) D. (1), (2), (3), (6), (7)

Câu 13: Hợp chất X có công thức cấu tạo CH3OOCCH2CH3. Tên gọi của X là:

A. etyl axetat B. metyl propionat C. metyl axetat D. propyl axetat

Câu 14: Este C4H8O2 tham gia phản ứng tráng bạc có thể có tên sau

A. Etyl fomat B. Propyl fomat C. Isopropyl fomat D. B, C đều đúng

Câu 15: X, Y là hỗn hợp 2 este đồng phân được tạo thành từ một cùng một ancol đơn chức với hai axit đơn chức đồng phân của nhau. Tỉ khối hơi của hỗn hợp so với hiđro bằng 51. Công thức phân tử của X, Y là

A. C3H6O2 B. C4H8O2 C. C5H10O2 D. C6H12O2

Câu 16: Số đồng phân este ng với công thức phân tử C4H8O2

A. 5. B. 2. C. 4. D. 6.

Câu 17: Số đồng phân este mạch hở ứng với công thức phân tử C4H6O2 là:

A. 5 B. 2 C. 4 D. 6

Câu 18: C4H6O2 có bao nhiêu đồng phân cấu tạo mạch hở phản ứng được với dung dịch NaOH?

A. 7 B. 8 C. 5 D. 6

Câu 19: Số đồng phân mạch hở đơn chức ứng với công thức phân tử C4H8O2 tác dụng với NaOH là:

A. 5 B. 2 C. 4 D. 6

Câu 20: Số hợp chất đơn chức, đồng phân cấu tạo của nhau có cùng công thức phân tử C4H8O2, đều tác dụng với dung dịch NaOH không tác dụng với Na là

A. 3 B. 4 C. 5 D. 6

Câu 21: Hai este đơn chức X và Y là đồng phân của nhau. Khi hoá hơi 1,85 gam X, thu được thể tích hơi đúng bằng thể tích của 0,7 gam N2 ( đo ở cùng điều kiện). Công thức cấu tạo thu gọn của X, Y là

A.C2H5COOCH3 và HCOOCH(CH3)2 B. HCOOC2H5 và CH3COOCH3

C.C2H3COOC2H5 và C2H5COOC2H3 D. HCOOCH2CH2CH3 và CH3COOC2H5

Câu 22: Đốt chất X có M=74 thu được CO2 và H2O. X mạch hở tác dụng với Na, NaHCO3 , AgNO3/NH3. Công thức của X là ?

A. C4H10O B. C3H6O2 C. C2H2O3 D. Tất cả sai

Câu 23: Cho sơ đồ phản ứng :

(1) X + Br2 + H2O axit cacboxylic Y1 + HBr
(2) X + H
2 ancol Y2 (3) Y1 + Y2 Y3 + H2O

Biết Y3 có công thức phân tử C6H10O2. Tên gọi của X là:

A. anđehit acrylic B. anđehit propionic C. anđehit metacrylic D. andehit axetic

Câu 24: A13 Cho sơ đồ các phản ứng:

X + NaOH (dung dịch) Y + Z; Y + NaOH (rắn) T + P;

T Q + H2; Q + H2O Z.

Trong sơ đồ trên, X và Z lần lượt là

A. HCOOCH=CH2 và HCHO B. CH3COOC2H5 và CH3CHO

C. CH3COOCH=CH2 và CH3CHO D. CH3COOCH=CH2 và HCHO

Câu 25: Chất nào có nhiệt độ sôi thấp nhất?

A. HCOOC2H5 B. HCOOH C. CH3COOC2H5 D. CH3OH

Câu 26: Cho các chất: CH3OH, CH3COOCH3, CH3COOH, C2H3COOCH3, C2H5OH, HCOOH. Sắp xếp các chất sau theo nhiệt độ sôi tăng dần theo thứ tự

A. CH3OH, HCOOH, C2H5OH, CH3COOH, CH3COOCH3, C2H3COOCH3

B. CH3COOCH3, C2H3COOCH3, CH3OH, HCOOH, CH3COOH, C2H5OH

C. C2H3COOCH3, CH3COOCH3, CH3OH, HCOOH, C2H5OH, CH3COOH

D. CH3COOCH3, C2H3COOCH3, CH3OH, C2H5OH, HCOOH, CH3COOH

 

O2 Education gửi các thầy cô link download file word

ON THI TN – BẢN IN CHO HS

ON THI TN-SOAN – Giao an

 

Xem thêm